You can not select more than 25 topics
Topics must start with a letter or number, can include dashes ('-') and can be up to 35 characters long.
3187 lines
96 KiB
3187 lines
96 KiB
/****************************************************************************
|
|
**
|
|
** Implementation of TQPainter class for X11
|
|
**
|
|
** Created : 940112
|
|
**
|
|
** Copyright (C) 1992-2008 Trolltech ASA. All rights reserved.
|
|
**
|
|
** This file is part of the kernel module of the TQt GUI Toolkit.
|
|
**
|
|
** This file may be used under the terms of the GNU General
|
|
** Public License versions 2.0 or 3.0 as published by the Free
|
|
** Software Foundation and appearing in the files LICENSE.GPL2
|
|
** and LICENSE.GPL3 included in the packaging of this file.
|
|
** Alternatively you may (at your option) use any later version
|
|
** of the GNU General Public License if such license has been
|
|
** publicly approved by Trolltech ASA (or its successors, if any)
|
|
** and the KDE Free TQt Foundation.
|
|
**
|
|
** Please review the following information to ensure GNU General
|
|
** Public Licensing requirements will be met:
|
|
** http://trolltech.com/products/qt/licenses/licensing/opensource/.
|
|
** If you are unsure which license is appropriate for your use, please
|
|
** review the following information:
|
|
** http://trolltech.com/products/qt/licenses/licensing/licensingoverview
|
|
** or contact the sales department at sales@trolltech.com.
|
|
**
|
|
** This file may be used under the terms of the Q Public License as
|
|
** defined by Trolltech ASA and appearing in the file LICENSE.TQPL
|
|
** included in the packaging of this file. Licensees holding valid TQt
|
|
** Commercial licenses may use this file in accordance with the TQt
|
|
** Commercial License Agreement provided with the Software.
|
|
**
|
|
** This file is provided "AS IS" with NO WARRANTY OF ANY KIND,
|
|
** INCLUDING THE WARRANTIES OF DESIGN, MERCHANTABILITY AND FITNESS FOR
|
|
** A PARTICULAR PURPOSE. Trolltech reserves all rights not granted
|
|
** herein.
|
|
**
|
|
**********************************************************************/
|
|
|
|
#include "qplatformdefs.h"
|
|
|
|
#include "ntqfont.h"
|
|
#include "ntqpainter.h"
|
|
#include "ntqwidget.h"
|
|
#include "ntqbitmap.h"
|
|
#include "ntqpixmapcache.h"
|
|
#include "ntqtextcodec.h"
|
|
#include "ntqpaintdevicemetrics.h"
|
|
|
|
#include "qt_x11_p.h"
|
|
|
|
#include "qtextlayout_p.h"
|
|
#include "qfontdata_p.h"
|
|
#include "qfontengine_p.h"
|
|
#include "qtextengine_p.h"
|
|
|
|
#include <math.h>
|
|
|
|
// paintevent magic to provide Windows semantics on X11
|
|
static TQRegion* paintEventClipRegion = 0;
|
|
static TQPaintDevice* paintEventDevice = 0;
|
|
|
|
void qt_set_paintevent_clipping( TQPaintDevice* dev, const TQRegion& region)
|
|
{
|
|
if ( !paintEventClipRegion )
|
|
paintEventClipRegion = new TQRegion( region );
|
|
else
|
|
*paintEventClipRegion = region;
|
|
paintEventDevice = dev;
|
|
}
|
|
|
|
void qt_clear_paintevent_clipping()
|
|
{
|
|
delete paintEventClipRegion;
|
|
paintEventClipRegion = 0;
|
|
paintEventDevice = 0;
|
|
}
|
|
|
|
class TQWFlagWidget : public TQWidget
|
|
{
|
|
public:
|
|
void setWState( WFlags f ) { TQWidget::setWState(f); }
|
|
void clearWState( WFlags f ) { TQWidget::clearWState(f); }
|
|
void setWFlags( WFlags f ) { TQWidget::setWFlags(f); }
|
|
void clearWFlags( WFlags f ) { TQWidget::clearWFlags(f); }
|
|
};
|
|
|
|
void qt_erase_region( TQWidget* w, const TQRegion& region)
|
|
{
|
|
TQRegion reg = region;
|
|
|
|
if ( TQPainter::redirect(w) || (!w->isTopLevel() && w->backgroundPixmap()
|
|
&& w->backgroundOrigin() != TQWidget::WidgetOrigin) ) {
|
|
TQPoint offset = w->backgroundOffset();
|
|
int ox = offset.x();
|
|
int oy = offset.y();
|
|
|
|
bool unclipped = w->testWFlags( TQt::WPaintUnclipped );
|
|
if ( unclipped )
|
|
((TQWFlagWidget*)w)->clearWFlags( TQt::WPaintUnclipped );
|
|
TQPainter p( w );
|
|
p.setClipRegion( region ); // automatically includes paintEventDevice if required
|
|
if ( w->backgroundPixmap() )
|
|
p.drawTiledPixmap( 0, 0, w->width(), w->height(),
|
|
*w->backgroundPixmap(), ox, oy );
|
|
else
|
|
p.fillRect( w->rect(), w->eraseColor() );
|
|
if ( unclipped )
|
|
((TQWFlagWidget*)w)->setWFlags( TQt::WPaintUnclipped );
|
|
return;
|
|
}
|
|
|
|
if ( w == paintEventDevice && paintEventClipRegion )
|
|
reg = paintEventClipRegion->intersect( reg );
|
|
|
|
TQMemArray<TQRect> r = reg.rects();
|
|
for (uint i=0; i<r.size(); i++) {
|
|
const TQRect& rr = r[(int)i];
|
|
XClearArea( w->x11Display(), w->winId(),
|
|
rr.x(), rr.y(), rr.width(), rr.height(), False );
|
|
}
|
|
}
|
|
|
|
void qt_erase_rect( TQWidget* w, const TQRect& r)
|
|
{
|
|
if ( TQPainter::redirect(w) || w == paintEventDevice
|
|
|| w->backgroundOrigin() != TQWidget::WidgetOrigin )
|
|
qt_erase_region( w, r );
|
|
else
|
|
XClearArea( w->x11Display(), w->winId(), r.x(), r.y(), r.width(), r.height(), False );
|
|
|
|
}
|
|
|
|
#ifdef QT_NO_XFTFREETYPE
|
|
static const TQt::HANDLE rendhd = 0;
|
|
#endif
|
|
|
|
// hack, so we don't have to make TQRegion::clipRectangles() public or include
|
|
// X11 headers in ntqregion.h
|
|
inline void *qt_getClipRects( const TQRegion &r, int &num )
|
|
{
|
|
return r.clipRectangles( num );
|
|
}
|
|
|
|
static inline void x11SetClipRegion(Display *dpy, GC gc, GC gc2, TQt::HANDLE draw, const TQRegion &r)
|
|
{
|
|
int num;
|
|
XRectangle *rects = (XRectangle *)qt_getClipRects( r, num );
|
|
|
|
if (gc)
|
|
XSetClipRectangles( dpy, gc, 0, 0, rects, num, YXBanded );
|
|
if (gc2)
|
|
XSetClipRectangles( dpy, gc2, 0, 0, rects, num, YXBanded );
|
|
|
|
#ifndef QT_NO_XFTFREETYPE
|
|
if (draw)
|
|
XftDrawSetClipRectangles((XftDraw *) draw, 0, 0, rects, num);
|
|
#else
|
|
Q_UNUSED(draw);
|
|
#endif // QT_NO_XFTFREETYPE
|
|
}
|
|
|
|
static inline void x11ClearClipRegion(Display *dpy, GC gc, GC gc2, TQt::HANDLE draw)
|
|
{
|
|
if (gc)
|
|
XSetClipMask(dpy, gc, None);
|
|
if (gc2)
|
|
XSetClipMask(dpy, gc2, None);
|
|
|
|
#ifndef QT_NO_XFTFREETYPE
|
|
if (draw) {
|
|
# ifdef QT_XFT2
|
|
XftDrawSetClip((XftDraw *) draw, None);
|
|
# else
|
|
// stupid Xft1
|
|
Picture pict = XftDrawPicture((XftDraw *) draw);
|
|
XRenderPictureAttributes pattr;
|
|
pattr.clip_mask = None;
|
|
XRenderChangePicture(dpy, pict, CPClipMask, &pattr);
|
|
# endif // QT_XFT2
|
|
}
|
|
#else
|
|
Q_UNUSED(draw);
|
|
#endif // QT_NO_XFTFREETYPE
|
|
}
|
|
|
|
|
|
/*****************************************************************************
|
|
Trigonometric function for TQPainter
|
|
|
|
We have implemented simple sine and cosine function that are called from
|
|
TQPainter::drawPie() and TQPainter::drawChord() when drawing the outline of
|
|
pies and chords.
|
|
These functions are slower and less accurate than math.h sin() and cos(),
|
|
but with still around 1/70000th sec. execution time (on a 486DX2-66) and
|
|
8 digits accuracy, it should not be the bottleneck in drawing these shapes.
|
|
The advantage is that you don't have to link in the math library.
|
|
*****************************************************************************/
|
|
|
|
const double Q_PI = 3.14159265358979323846; // pi
|
|
const double Q_2PI = 6.28318530717958647693; // 2*pi
|
|
const double Q_PI2 = 1.57079632679489661923; // pi/2
|
|
|
|
|
|
#if defined(Q_CC_GNU) && defined(Q_OS_AIX)
|
|
// AIX 4.2 gcc 2.7.2.3 gets internal error.
|
|
static int tqRoundAIX( double d )
|
|
{
|
|
return tqRound(d);
|
|
}
|
|
#define tqRound tqRoundAIX
|
|
#endif
|
|
|
|
|
|
#if defined(Q_CC_GNU) && defined(__i386__)
|
|
|
|
inline double qcos( double a )
|
|
{
|
|
double r;
|
|
__asm__ (
|
|
"fcos"
|
|
: "=t" (r) : "0" (a) );
|
|
return(r);
|
|
}
|
|
|
|
inline double qsin( double a )
|
|
{
|
|
double r;
|
|
__asm__ (
|
|
"fsin"
|
|
: "=t" (r) : "0" (a) );
|
|
return(r);
|
|
}
|
|
|
|
double qsincos( double a, bool calcCos=FALSE )
|
|
{
|
|
return calcCos ? qcos(a) : qsin(a);
|
|
}
|
|
|
|
#else
|
|
|
|
double qsincos( double a, bool calcCos=FALSE )
|
|
{
|
|
if ( calcCos ) // calculate cosine
|
|
a -= Q_PI2;
|
|
if ( a >= Q_2PI || a <= -Q_2PI ) { // fix range: -2*pi < a < 2*pi
|
|
int m = (int)(a/Q_2PI);
|
|
a -= Q_2PI*m;
|
|
}
|
|
if ( a < 0.0 ) // 0 <= a < 2*pi
|
|
a += Q_2PI;
|
|
int sign = a > Q_PI ? -1 : 1;
|
|
if ( a >= Q_PI )
|
|
a = Q_2PI - a;
|
|
if ( a >= Q_PI2 )
|
|
a = Q_PI - a;
|
|
if ( calcCos )
|
|
sign = -sign;
|
|
double a2 = a*a; // here: 0 <= a < pi/4
|
|
double a3 = a2*a; // make taylor sin sum
|
|
double a5 = a3*a2;
|
|
double a7 = a5*a2;
|
|
double a9 = a7*a2;
|
|
double a11 = a9*a2;
|
|
return (a-a3/6+a5/120-a7/5040+a9/362880-a11/39916800)*sign;
|
|
}
|
|
|
|
inline double qsin( double a ) { return qsincos(a, FALSE); }
|
|
inline double qcos( double a ) { return qsincos(a, TRUE); }
|
|
|
|
#endif
|
|
|
|
|
|
/*****************************************************************************
|
|
TQPainter internal GC (Graphics Context) allocator.
|
|
|
|
The GC allocator offers two functions; alloc_gc() and free_gc() that
|
|
reuse GC objects instead of calling XCreateGC() and XFreeGC(), which
|
|
are a whole lot slower.
|
|
*****************************************************************************/
|
|
|
|
struct TQGC
|
|
{
|
|
GC gc;
|
|
char in_use;
|
|
bool mono;
|
|
int scrn;
|
|
};
|
|
|
|
const int gc_array_size = 256;
|
|
static TQGC gc_array[gc_array_size]; // array of GCs
|
|
static bool gc_array_init = FALSE;
|
|
|
|
|
|
static void init_gc_array()
|
|
{
|
|
if ( !gc_array_init ) {
|
|
memset( gc_array, 0, gc_array_size*sizeof(TQGC) );
|
|
gc_array_init = TRUE;
|
|
}
|
|
}
|
|
|
|
static void cleanup_gc_array( Display *dpy )
|
|
{
|
|
register TQGC *p = gc_array;
|
|
int i = gc_array_size;
|
|
if ( gc_array_init ) {
|
|
while ( i-- ) {
|
|
if ( p->gc ) // destroy GC
|
|
XFreeGC( dpy, p->gc );
|
|
p++;
|
|
}
|
|
gc_array_init = FALSE;
|
|
}
|
|
}
|
|
|
|
// #define DONT_USE_GC_ARRAY
|
|
|
|
static GC alloc_gc( Display *dpy, int scrn, Drawable hd, bool monochrome=FALSE,
|
|
bool privateGC = FALSE )
|
|
{
|
|
#if defined(DONT_USE_GC_ARRAY)
|
|
privateGC = TRUE; // will be slower
|
|
#endif
|
|
if ( privateGC ) {
|
|
GC gc = XCreateGC( dpy, hd, 0, 0 );
|
|
XSetGraphicsExposures( dpy, gc, False );
|
|
return gc;
|
|
}
|
|
register TQGC *p = gc_array;
|
|
int i = gc_array_size;
|
|
if ( !gc_array_init ) // not initialized
|
|
init_gc_array();
|
|
while ( i-- ) {
|
|
if ( !p->gc ) { // create GC (once)
|
|
p->gc = XCreateGC( dpy, hd, 0, 0 );
|
|
p->scrn = scrn;
|
|
XSetGraphicsExposures( dpy, p->gc, False );
|
|
p->in_use = FALSE;
|
|
p->mono = monochrome;
|
|
}
|
|
if ( !p->in_use && p->mono == monochrome && p->scrn == scrn ) {
|
|
p->in_use = TRUE; // available/compatible GC
|
|
return p->gc;
|
|
}
|
|
p++;
|
|
}
|
|
#if defined(QT_CHECK_NULL)
|
|
tqWarning( "TQPainter: Internal error; no available GC" );
|
|
#endif
|
|
GC gc = XCreateGC( dpy, hd, 0, 0 );
|
|
XSetGraphicsExposures( dpy, gc, False );
|
|
return gc;
|
|
}
|
|
|
|
static void free_gc( Display *dpy, GC gc, bool privateGC = FALSE )
|
|
{
|
|
#if defined(DONT_USE_GC_ARRAY)
|
|
privateGC = TRUE; // will be slower
|
|
#endif
|
|
if ( privateGC ) {
|
|
Q_ASSERT( dpy != 0 );
|
|
XFreeGC( dpy, gc );
|
|
return;
|
|
}
|
|
register TQGC *p = gc_array;
|
|
int i = gc_array_size;
|
|
if ( gc_array_init ) {
|
|
while ( i-- ) {
|
|
if ( p->gc == gc ) {
|
|
p->in_use = FALSE; // set available
|
|
XSetClipMask( dpy, gc, None ); // make it reusable
|
|
XSetFunction( dpy, gc, GXcopy );
|
|
XSetFillStyle( dpy, gc, FillSolid );
|
|
XSetTSOrigin( dpy, gc, 0, 0 );
|
|
return;
|
|
}
|
|
p++;
|
|
}
|
|
}
|
|
|
|
// not found in gc_array
|
|
XFreeGC(dpy, gc);
|
|
}
|
|
|
|
|
|
/*****************************************************************************
|
|
TQPainter internal GC (Graphics Context) cache for solid pens and
|
|
brushes.
|
|
|
|
The GC cache makes a significant contribution to speeding up
|
|
drawing. Setting new pen and brush colors will make the painter
|
|
look for another GC with the same color instead of changing the
|
|
color value of the GC currently in use. The cache structure is
|
|
optimized for fast lookup. Only solid line pens with line width 0
|
|
and solid brushes are cached.
|
|
|
|
In addition, stored GCs may have an implicit clipping region
|
|
set. This prevents any drawing outside paint events. Both
|
|
updatePen() and updateBrush() keep track of the validity of this
|
|
clipping region by storing the clip_serial number in the cache.
|
|
|
|
*****************************************************************************/
|
|
|
|
struct TQGCC // cached GC
|
|
{
|
|
GC gc;
|
|
uint pix;
|
|
int count;
|
|
int hits;
|
|
uint clip_serial;
|
|
int scrn;
|
|
};
|
|
|
|
const int gc_cache_size = 29; // multiply by 4
|
|
static TQGCC *gc_cache_buf;
|
|
static TQGCC *gc_cache[4*gc_cache_size];
|
|
static bool gc_cache_init = FALSE;
|
|
static uint gc_cache_clip_serial = 0;
|
|
|
|
|
|
static void init_gc_cache()
|
|
{
|
|
if ( !gc_cache_init ) {
|
|
gc_cache_init = TRUE;
|
|
gc_cache_clip_serial = 0;
|
|
TQGCC *g = gc_cache_buf = new TQGCC[4*gc_cache_size];
|
|
memset( g, 0, 4*gc_cache_size*sizeof(TQGCC) );
|
|
for ( int i=0; i<4*gc_cache_size; i++ )
|
|
gc_cache[i] = g++;
|
|
}
|
|
}
|
|
|
|
|
|
// #define GC_CACHE_STAT
|
|
#if defined(GC_CACHE_STAT)
|
|
#include "ntqtextstream.h"
|
|
#include "ntqbuffer.h"
|
|
|
|
static int g_numhits = 0;
|
|
static int g_numcreates = 0;
|
|
static int g_numfaults = 0;
|
|
#endif
|
|
|
|
|
|
static void cleanup_gc_cache()
|
|
{
|
|
if ( !gc_cache_init )
|
|
return;
|
|
#if defined(GC_CACHE_STAT)
|
|
tqDebug( "Number of cache hits = %d", g_numhits );
|
|
tqDebug( "Number of cache creates = %d", g_numcreates );
|
|
tqDebug( "Number of cache faults = %d", g_numfaults );
|
|
for ( int i=0; i<gc_cache_size; i++ ) {
|
|
TQCString str;
|
|
TQBuffer buf( str );
|
|
buf.open(IO_ReadWrite);
|
|
TQTextStream s(&buf);
|
|
s << i << ": ";
|
|
for ( int j=0; j<4; j++ ) {
|
|
TQGCC *g = gc_cache[i*4+j];
|
|
s << (g->gc ? 'X' : '-') << ',' << g->hits << ','
|
|
<< g->count << '\t';
|
|
}
|
|
s << '\0';
|
|
tqDebug( str );
|
|
buf.close();
|
|
}
|
|
#endif
|
|
delete [] gc_cache_buf;
|
|
gc_cache_init = FALSE;
|
|
}
|
|
|
|
|
|
static bool obtain_gc( void **ref, GC *gc, uint pix, Display *dpy, int scrn,
|
|
TQt::HANDLE hd, uint painter_clip_serial )
|
|
{
|
|
if ( !gc_cache_init )
|
|
init_gc_cache();
|
|
|
|
int k = (pix % gc_cache_size) * 4;
|
|
TQGCC *g = gc_cache[k];
|
|
TQGCC *prev = 0;
|
|
|
|
#define NOMATCH (g->gc && (g->pix != pix || g->scrn != scrn || \
|
|
(g->clip_serial > 0 && g->clip_serial != painter_clip_serial)))
|
|
|
|
if ( NOMATCH ) {
|
|
prev = g;
|
|
g = gc_cache[++k];
|
|
if ( NOMATCH ) {
|
|
prev = g;
|
|
g = gc_cache[++k];
|
|
if ( NOMATCH ) {
|
|
prev = g;
|
|
g = gc_cache[++k];
|
|
if ( NOMATCH ) {
|
|
if ( g->count == 0 && g->scrn == scrn) { // steal this GC
|
|
g->pix = pix;
|
|
g->count = 1;
|
|
g->hits = 1;
|
|
g->clip_serial = 0;
|
|
XSetForeground( dpy, g->gc, pix );
|
|
XSetClipMask(dpy, g->gc, None);
|
|
gc_cache[k] = prev;
|
|
gc_cache[k-1] = g;
|
|
*ref = (void *)g;
|
|
*gc = g->gc;
|
|
return TRUE;
|
|
} else { // all GCs in use
|
|
#if defined(GC_CACHE_STAT)
|
|
g_numfaults++;
|
|
#endif
|
|
*ref = 0;
|
|
return FALSE;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
#undef NOMATCH
|
|
|
|
*ref = (void *)g;
|
|
|
|
if ( g->gc ) { // reuse existing GC
|
|
#if defined(GC_CACHE_STAT)
|
|
g_numhits++;
|
|
#endif
|
|
*gc = g->gc;
|
|
g->count++;
|
|
g->hits++;
|
|
if ( prev && g->hits > prev->hits ) { // maintain LRU order
|
|
gc_cache[k] = prev;
|
|
gc_cache[k-1] = g;
|
|
}
|
|
return TRUE;
|
|
} else { // create new GC
|
|
#if defined(GC_CACHE_STAT)
|
|
g_numcreates++;
|
|
#endif
|
|
g->gc = alloc_gc( dpy, scrn, hd, FALSE );
|
|
g->scrn = scrn;
|
|
g->pix = pix;
|
|
g->count = 1;
|
|
g->hits = 1;
|
|
g->clip_serial = 0;
|
|
*gc = g->gc;
|
|
return FALSE;
|
|
}
|
|
}
|
|
|
|
static inline void release_gc( void *ref )
|
|
{
|
|
((TQGCC*)ref)->count--;
|
|
}
|
|
|
|
/*****************************************************************************
|
|
TQPainter member functions
|
|
*****************************************************************************/
|
|
|
|
/*!
|
|
\internal
|
|
|
|
Internal function that initializes the painter.
|
|
*/
|
|
|
|
void TQPainter::initialize()
|
|
{
|
|
init_gc_array();
|
|
init_gc_cache();
|
|
}
|
|
|
|
/*!
|
|
\internal
|
|
|
|
Internal function that cleans up the painter.
|
|
*/
|
|
|
|
void TQPainter::cleanup()
|
|
{
|
|
cleanup_gc_cache();
|
|
cleanup_gc_array( TQPaintDevice::x11AppDisplay() );
|
|
TQPointArray::cleanBuffers();
|
|
}
|
|
|
|
/*!
|
|
\internal
|
|
|
|
Internal function that destroys up the painter.
|
|
*/
|
|
|
|
void TQPainter::destroy()
|
|
{
|
|
|
|
}
|
|
|
|
void TQPainter::init()
|
|
{
|
|
d = 0;
|
|
flags = IsStartingUp;
|
|
bg_col = white; // default background color
|
|
bg_mode = TransparentMode; // default background mode
|
|
rop = CopyROP; // default ROP
|
|
tabstops = 0; // default tabbing
|
|
tabarray = 0;
|
|
tabarraylen = 0;
|
|
ps_stack = 0;
|
|
wm_stack = 0;
|
|
gc = gc_brush = 0;
|
|
pdev = 0;
|
|
dpy = 0;
|
|
txop = txinv = 0;
|
|
penRef = brushRef = 0;
|
|
clip_serial = 0;
|
|
pfont = 0;
|
|
block_ext = FALSE;
|
|
}
|
|
|
|
|
|
/*!
|
|
\fn const TQFont &TQPainter::font() const
|
|
|
|
Returns the currently set painter font.
|
|
|
|
\sa setFont(), TQFont
|
|
*/
|
|
|
|
/*!
|
|
Sets the painter's font to \a font.
|
|
|
|
This font is used by subsequent drawText() functions. The text
|
|
color is the same as the pen color.
|
|
|
|
\sa font(), drawText()
|
|
*/
|
|
|
|
void TQPainter::setFont( const TQFont &font )
|
|
{
|
|
#if defined(QT_CHECK_STATE)
|
|
if ( !isActive() )
|
|
tqWarning( "TQPainter::setFont: Will be reset by begin()" );
|
|
#endif
|
|
if ( cfont.d != font.d ) {
|
|
cfont = font;
|
|
cfont.x11SetScreen( scrn );
|
|
setf(DirtyFont);
|
|
}
|
|
}
|
|
|
|
|
|
void TQPainter::updateFont()
|
|
{
|
|
if (!isActive())
|
|
return;
|
|
|
|
clearf(DirtyFont);
|
|
if ( testf(ExtDev) ) {
|
|
if (pdev->devType() == TQInternal::Printer) {
|
|
if ( pfont ) delete pfont;
|
|
pfont = new TQFont( cfont.d, pdev );
|
|
}
|
|
TQPDevCmdParam param[1];
|
|
param[0].font = &cfont;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetFont, this, param ) || !hd )
|
|
return;
|
|
}
|
|
setf(NoCache);
|
|
if ( penRef )
|
|
updatePen(); // force a non-cached GC
|
|
}
|
|
|
|
|
|
void TQPainter::updatePen()
|
|
{
|
|
if (!isActive())
|
|
return;
|
|
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].pen = &cpen;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetPen, this, param ) || !hd )
|
|
return;
|
|
}
|
|
|
|
int ps = cpen.style();
|
|
bool cacheIt = !testf(ClipOn|MonoDev|NoCache) &&
|
|
(ps == NoPen || ps == SolidLine) &&
|
|
cpen.width() == 0 && rop == CopyROP;
|
|
|
|
bool obtained = FALSE;
|
|
bool internclipok = hasClipping();
|
|
if ( cacheIt ) {
|
|
if ( gc ) {
|
|
if ( penRef )
|
|
release_gc( penRef );
|
|
else
|
|
free_gc( dpy, gc );
|
|
}
|
|
obtained = obtain_gc(&penRef, &gc, cpen.color().pixel(scrn), dpy, scrn,
|
|
hd, clip_serial);
|
|
if ( !obtained && !penRef )
|
|
gc = alloc_gc( dpy, scrn, hd, FALSE );
|
|
} else {
|
|
if ( gc ) {
|
|
if ( penRef ) {
|
|
release_gc( penRef );
|
|
penRef = 0;
|
|
gc = alloc_gc( dpy, scrn, hd, testf(MonoDev) );
|
|
} else {
|
|
internclipok = TRUE;
|
|
}
|
|
} else {
|
|
gc = alloc_gc( dpy, scrn, hd, testf(MonoDev), testf(UsePrivateCx) );
|
|
}
|
|
}
|
|
|
|
if ( !internclipok ) {
|
|
if ( pdev == paintEventDevice && paintEventClipRegion ) {
|
|
if ( penRef &&((TQGCC*)penRef)->clip_serial < gc_cache_clip_serial ) {
|
|
x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
|
|
((TQGCC*)penRef)->clip_serial = gc_cache_clip_serial;
|
|
} else if ( !penRef ) {
|
|
x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
|
|
}
|
|
} else if (penRef && ((TQGCC*)penRef)->clip_serial ) {
|
|
x11ClearClipRegion(dpy, gc, 0, rendhd);
|
|
((TQGCC*)penRef)->clip_serial = 0;
|
|
}
|
|
}
|
|
|
|
if ( obtained )
|
|
return;
|
|
|
|
char dashes[10]; // custom pen dashes
|
|
int dash_len = 0; // length of dash list
|
|
int s = LineSolid;
|
|
int cp = CapButt;
|
|
int jn = JoinMiter;
|
|
|
|
/*
|
|
We are emulating Windows here. Windows treats cpen.width() == 1
|
|
(or 0) as a very special case. The fudge variable unifies this
|
|
case with the general case.
|
|
*/
|
|
int dot = cpen.width(); // width of a dot
|
|
int fudge = 1;
|
|
bool allow_zero_lw = TRUE;
|
|
if ( dot <= 1 ) {
|
|
dot = 3;
|
|
fudge = 2;
|
|
}
|
|
|
|
switch( ps ) {
|
|
case NoPen:
|
|
case SolidLine:
|
|
s = LineSolid;
|
|
break;
|
|
case DashLine:
|
|
dashes[0] = fudge * 3 * dot;
|
|
dashes[1] = fudge * dot;
|
|
dash_len = 2;
|
|
allow_zero_lw = FALSE;
|
|
break;
|
|
case DotLine:
|
|
dashes[0] = dot;
|
|
dashes[1] = dot;
|
|
dash_len = 2;
|
|
allow_zero_lw = FALSE;
|
|
break;
|
|
case DashDotLine:
|
|
dashes[0] = 3 * dot;
|
|
dashes[1] = fudge * dot;
|
|
dashes[2] = dot;
|
|
dashes[3] = fudge * dot;
|
|
dash_len = 4;
|
|
allow_zero_lw = FALSE;
|
|
break;
|
|
case DashDotDotLine:
|
|
dashes[0] = 3 * dot;
|
|
dashes[1] = dot;
|
|
dashes[2] = dot;
|
|
dashes[3] = dot;
|
|
dashes[4] = dot;
|
|
dashes[5] = dot;
|
|
dash_len = 6;
|
|
allow_zero_lw = FALSE;
|
|
break;
|
|
case FineDotLine:
|
|
dot = 1;
|
|
dashes[0] = dot;
|
|
dashes[1] = dot;
|
|
dash_len = 2;
|
|
allow_zero_lw = FALSE;
|
|
}
|
|
Q_ASSERT( dash_len <= (int) sizeof(dashes) );
|
|
|
|
switch ( cpen.capStyle() ) {
|
|
case SquareCap:
|
|
cp = CapProjecting;
|
|
break;
|
|
case RoundCap:
|
|
cp = CapRound;
|
|
break;
|
|
case FlatCap:
|
|
default:
|
|
cp = CapButt;
|
|
break;
|
|
}
|
|
switch ( cpen.joinStyle() ) {
|
|
case BevelJoin:
|
|
jn = JoinBevel;
|
|
break;
|
|
case RoundJoin:
|
|
jn = JoinRound;
|
|
break;
|
|
case MiterJoin:
|
|
default:
|
|
jn = JoinMiter;
|
|
break;
|
|
}
|
|
|
|
XSetForeground( dpy, gc, cpen.color().pixel(scrn) );
|
|
XSetBackground( dpy, gc, bg_col.pixel(scrn) );
|
|
|
|
if ( dash_len ) { // make dash list
|
|
XSetDashes( dpy, gc, 0, dashes, dash_len );
|
|
s = bg_mode == TransparentMode ? LineOnOffDash : LineDoubleDash;
|
|
}
|
|
XSetLineAttributes( dpy, gc,
|
|
(! allow_zero_lw && cpen.width() == 0) ? 1 : cpen.width(),
|
|
s, cp, jn );
|
|
}
|
|
|
|
|
|
void TQPainter::updateBrush()
|
|
{
|
|
if (!isActive())
|
|
return;
|
|
|
|
static const uchar dense1_pat[] = { 0xff, 0xbb, 0xff, 0xff, 0xff, 0xbb, 0xff, 0xff };
|
|
static const uchar dense2_pat[] = { 0x77, 0xff, 0xdd, 0xff, 0x77, 0xff, 0xdd, 0xff };
|
|
static const uchar dense3_pat[] = { 0x55, 0xbb, 0x55, 0xee, 0x55, 0xbb, 0x55, 0xee };
|
|
static const uchar dense4_pat[] = { 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa };
|
|
static const uchar dense5_pat[] = { 0xaa, 0x44, 0xaa, 0x11, 0xaa, 0x44, 0xaa, 0x11 };
|
|
static const uchar dense6_pat[] = { 0x88, 0x00, 0x22, 0x00, 0x88, 0x00, 0x22, 0x00 };
|
|
static const uchar dense7_pat[] = { 0x00, 0x44, 0x00, 0x00, 0x00, 0x44, 0x00, 0x00 };
|
|
static const uchar hor_pat[] = { // horizontal pattern
|
|
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff,
|
|
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
|
0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
|
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff,
|
|
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
|
|
0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
|
|
static const uchar ver_pat[] = { // vertical pattern
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20 };
|
|
static const uchar cross_pat[] = { // cross pattern
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0xff, 0xff, 0xff,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0xff, 0xff, 0xff, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0xff, 0xff, 0xff,
|
|
0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
|
|
0x08, 0x82, 0x20, 0xff, 0xff, 0xff, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20 };
|
|
static const uchar bdiag_pat[] = { // backward diagonal pattern
|
|
0x20, 0x20, 0x10, 0x10, 0x08, 0x08, 0x04, 0x04, 0x02, 0x02, 0x01, 0x01,
|
|
0x80, 0x80, 0x40, 0x40, 0x20, 0x20, 0x10, 0x10, 0x08, 0x08, 0x04, 0x04,
|
|
0x02, 0x02, 0x01, 0x01, 0x80, 0x80, 0x40, 0x40 };
|
|
static const uchar fdiag_pat[] = { // forward diagonal pattern
|
|
0x02, 0x02, 0x04, 0x04, 0x08, 0x08, 0x10, 0x10, 0x20, 0x20, 0x40, 0x40,
|
|
0x80, 0x80, 0x01, 0x01, 0x02, 0x02, 0x04, 0x04, 0x08, 0x08, 0x10, 0x10,
|
|
0x20, 0x20, 0x40, 0x40, 0x80, 0x80, 0x01, 0x01 };
|
|
static const uchar dcross_pat[] = { // diagonal cross pattern
|
|
0x22, 0x22, 0x14, 0x14, 0x08, 0x08, 0x14, 0x14, 0x22, 0x22, 0x41, 0x41,
|
|
0x80, 0x80, 0x41, 0x41, 0x22, 0x22, 0x14, 0x14, 0x08, 0x08, 0x14, 0x14,
|
|
0x22, 0x22, 0x41, 0x41, 0x80, 0x80, 0x41, 0x41 };
|
|
static const uchar * const pat_tbl[] = {
|
|
dense1_pat, dense2_pat, dense3_pat, dense4_pat, dense5_pat,
|
|
dense6_pat, dense7_pat,
|
|
hor_pat, ver_pat, cross_pat, bdiag_pat, fdiag_pat, dcross_pat };
|
|
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].brush = &cbrush;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetBrush, this, param ) || !hd )
|
|
return;
|
|
}
|
|
|
|
int bs = cbrush.style();
|
|
bool cacheIt = !testf(ClipOn|MonoDev|NoCache) &&
|
|
(bs == NoBrush || bs == SolidPattern) &&
|
|
bro.x() == 0 && bro.y() == 0 && rop == CopyROP;
|
|
|
|
bool obtained = FALSE;
|
|
bool internclipok = hasClipping();
|
|
if ( cacheIt ) {
|
|
if ( gc_brush ) {
|
|
if ( brushRef )
|
|
release_gc( brushRef );
|
|
else
|
|
free_gc( dpy, gc_brush );
|
|
}
|
|
obtained = obtain_gc(&brushRef, &gc_brush, cbrush.color().pixel(scrn), dpy,
|
|
scrn, hd, clip_serial);
|
|
if ( !obtained && !brushRef )
|
|
gc_brush = alloc_gc( dpy, scrn, hd, FALSE );
|
|
} else {
|
|
if ( gc_brush ) {
|
|
if ( brushRef ) {
|
|
release_gc( brushRef );
|
|
brushRef = 0;
|
|
gc_brush = alloc_gc( dpy, scrn, hd, testf(MonoDev) );
|
|
} else {
|
|
internclipok = TRUE;
|
|
}
|
|
} else {
|
|
gc_brush = alloc_gc( dpy, scrn, hd, testf(MonoDev), testf(UsePrivateCx));
|
|
}
|
|
}
|
|
|
|
if ( !internclipok ) {
|
|
if ( pdev == paintEventDevice && paintEventClipRegion ) {
|
|
if ( brushRef &&((TQGCC*)brushRef)->clip_serial < gc_cache_clip_serial ) {
|
|
x11SetClipRegion( dpy, gc_brush, 0, rendhd, *paintEventClipRegion );
|
|
((TQGCC*)brushRef)->clip_serial = gc_cache_clip_serial;
|
|
} else if ( !brushRef ){
|
|
x11SetClipRegion( dpy, gc_brush, 0, rendhd, *paintEventClipRegion );
|
|
}
|
|
} else if (brushRef && ((TQGCC*)brushRef)->clip_serial ) {
|
|
x11ClearClipRegion(dpy, gc_brush, 0, rendhd);
|
|
((TQGCC*)brushRef)->clip_serial = 0;
|
|
}
|
|
}
|
|
|
|
if ( obtained )
|
|
return;
|
|
|
|
const uchar *pat = 0; // pattern
|
|
int d = 0; // defalt pattern size: d*d
|
|
int s = FillSolid;
|
|
if ( bs >= Dense1Pattern && bs <= DiagCrossPattern ) {
|
|
pat = pat_tbl[ bs-Dense1Pattern ];
|
|
if ( bs <= Dense7Pattern )
|
|
d = 8;
|
|
else if ( bs <= CrossPattern )
|
|
d = 24;
|
|
else
|
|
d = 16;
|
|
}
|
|
|
|
XSetLineAttributes( dpy, gc_brush, 0, LineSolid, CapButt, JoinMiter );
|
|
XSetForeground( dpy, gc_brush, cbrush.color().pixel(scrn) );
|
|
XSetBackground( dpy, gc_brush, bg_col.pixel(scrn) );
|
|
|
|
if ( bs == CustomPattern || pat ) {
|
|
TQPixmap *pm;
|
|
if ( pat ) {
|
|
TQString key;
|
|
key.sprintf( "$qt-brush$%d", bs );
|
|
pm = TQPixmapCache::find( key );
|
|
bool del = FALSE;
|
|
if ( !pm ) { // not already in pm dict
|
|
pm = new TQBitmap( d, d, pat, TRUE );
|
|
TQ_CHECK_PTR( pm );
|
|
del = !TQPixmapCache::insert( key, pm );
|
|
}
|
|
if ( cbrush.data->pixmap )
|
|
delete cbrush.data->pixmap;
|
|
cbrush.data->pixmap = new TQPixmap( *pm );
|
|
if (del) delete pm;
|
|
}
|
|
pm = cbrush.data->pixmap;
|
|
pm->x11SetScreen( scrn );
|
|
if ( pm->depth() == 1 ) {
|
|
XSetStipple( dpy, gc_brush, pm->handle() );
|
|
s = bg_mode == TransparentMode ? FillStippled : FillOpaqueStippled;
|
|
} else {
|
|
XSetTile( dpy, gc_brush, pm->handle() );
|
|
s = FillTiled;
|
|
}
|
|
}
|
|
XSetFillStyle( dpy, gc_brush, s );
|
|
}
|
|
|
|
|
|
/*!
|
|
Begins painting the paint device \a pd and returns TRUE if
|
|
successful; otherwise returns FALSE. If \a unclipped is TRUE, the
|
|
painting will not be clipped at the paint device's boundaries,
|
|
(although this is not supported by all platforms).
|
|
|
|
The errors that can occur are serious problems, such as these:
|
|
|
|
\code
|
|
p->begin( 0 ); // impossible - paint device cannot be 0
|
|
|
|
TQPixmap pm( 0, 0 );
|
|
p->begin( pm ); // impossible - pm.isNull();
|
|
|
|
p->begin( myWidget );
|
|
p2->begin( myWidget ); // impossible - only one painter at a time
|
|
\endcode
|
|
|
|
Note that most of the time, you can use one of the constructors
|
|
instead of begin(), and that end() is automatically done at
|
|
destruction.
|
|
|
|
\warning A paint device can only be painted by one painter at a
|
|
time.
|
|
|
|
\sa end(), flush()
|
|
*/
|
|
|
|
bool TQPainter::begin( const TQPaintDevice *pd, bool unclipped )
|
|
{
|
|
if ( isActive() ) { // already active painting
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::begin: Painter is already active."
|
|
"\n\tYou must end() the painter before a second begin()" );
|
|
#endif
|
|
return FALSE;
|
|
}
|
|
if ( pd == 0 ) {
|
|
#if defined(QT_CHECK_NULL)
|
|
tqWarning( "TQPainter::begin: Paint device cannot be null" );
|
|
#endif
|
|
return FALSE;
|
|
}
|
|
|
|
TQPixmap::x11SetDefaultScreen( pd->x11Screen() );
|
|
|
|
const TQWidget *copyFrom = 0;
|
|
pdev = redirect( (TQPaintDevice*)pd );
|
|
if ( pdev ) { // redirected paint device?
|
|
if ( pd->devType() == TQInternal::Widget )
|
|
copyFrom = (const TQWidget *)pd; // copy widget settings
|
|
} else {
|
|
pdev = (TQPaintDevice*)pd;
|
|
}
|
|
|
|
if ( pdev->isExtDev() && pdev->paintingActive() ) {
|
|
// somebody else is already painting
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::begin: Another TQPainter is already painting "
|
|
"this device;\n\tAn extended paint device can only be "
|
|
"painted by one TQPainter at a time." );
|
|
#endif
|
|
return FALSE;
|
|
}
|
|
|
|
bool reinit = flags != IsStartingUp; // 2nd or 3rd etc. time called
|
|
flags = IsActive | DirtyFont; // init flags
|
|
int dt = pdev->devType(); // get the device type
|
|
|
|
if ( (pdev->devFlags & TQInternal::ExternalDevice) != 0 )
|
|
setf(ExtDev);
|
|
else if ( dt == TQInternal::Pixmap ) // device is a pixmap
|
|
((TQPixmap*)pdev)->detach(); // will modify it
|
|
|
|
dpy = pdev->x11Display(); // get display variable
|
|
scrn = pdev->x11Screen(); // get screen variable
|
|
hd = pdev->handle(); // get handle to drawable
|
|
rendhd = pdev->rendhd;
|
|
|
|
if ( testf(ExtDev) ) { // external device
|
|
if ( !pdev->cmd( TQPaintDevice::PdcBegin, this, 0 ) ) {
|
|
// could not begin painting
|
|
if ( reinit )
|
|
clearf( IsActive | DirtyFont );
|
|
else
|
|
flags = IsStartingUp;
|
|
pdev = 0;
|
|
return FALSE;
|
|
}
|
|
if ( tabstops ) // update tabstops for device
|
|
setTabStops( tabstops );
|
|
if ( tabarray ) // update tabarray for device
|
|
setTabArray( tabarray );
|
|
}
|
|
|
|
if ( pdev->x11Depth() != pdev->x11AppDepth( scrn ) ) { // non-standard depth
|
|
setf(NoCache);
|
|
setf(UsePrivateCx);
|
|
}
|
|
|
|
pdev->painters++; // also tell paint device
|
|
bro = curPt = TQPoint( 0, 0 );
|
|
if ( reinit ) {
|
|
bg_mode = TransparentMode; // default background mode
|
|
rop = CopyROP; // default ROP
|
|
wxmat.reset(); // reset world xform matrix
|
|
xmat.reset();
|
|
ixmat.reset();
|
|
txop = txinv = 0;
|
|
if ( dt != TQInternal::Widget ) {
|
|
TQFont defaultFont; // default drawing tools
|
|
TQPen defaultPen;
|
|
TQBrush defaultBrush;
|
|
cfont = defaultFont; // set these drawing tools
|
|
cpen = defaultPen;
|
|
cbrush = defaultBrush;
|
|
bg_col = white; // default background color
|
|
}
|
|
}
|
|
wx = wy = vx = vy = 0; // default view origins
|
|
|
|
if ( dt == TQInternal::Widget ) { // device is a widget
|
|
TQWidget *w = (TQWidget*)pdev;
|
|
cfont = w->font(); // use widget font
|
|
cpen = TQPen( w->foregroundColor() ); // use widget fg color
|
|
if ( reinit ) {
|
|
TQBrush defaultBrush;
|
|
cbrush = defaultBrush;
|
|
}
|
|
bg_col = w->backgroundColor(); // use widget bg color
|
|
ww = vw = w->width(); // default view size
|
|
wh = vh = w->height();
|
|
if ( unclipped || w->testWFlags( WPaintUnclipped ) ) { // paint direct on device
|
|
setf( NoCache );
|
|
setf(UsePrivateCx);
|
|
updatePen();
|
|
updateBrush();
|
|
XSetSubwindowMode( dpy, gc, IncludeInferiors );
|
|
XSetSubwindowMode( dpy, gc_brush, IncludeInferiors );
|
|
#ifndef QT_NO_XFTFREETYPE
|
|
if (rendhd)
|
|
XftDrawSetSubwindowMode((XftDraw *) rendhd, IncludeInferiors);
|
|
#endif
|
|
}
|
|
} else if ( dt == TQInternal::Pixmap ) { // device is a pixmap
|
|
TQPixmap *pm = (TQPixmap*)pdev;
|
|
if ( pm->isNull() ) {
|
|
#if defined(QT_CHECK_NULL)
|
|
tqWarning( "TQPainter::begin: Cannot paint null pixmap" );
|
|
#endif
|
|
end();
|
|
return FALSE;
|
|
}
|
|
bool mono = pm->depth() == 1; // monochrome bitmap
|
|
if ( mono ) {
|
|
setf( MonoDev );
|
|
bg_col = color0;
|
|
cpen.setColor( color1 );
|
|
}
|
|
ww = vw = pm->width(); // default view size
|
|
wh = vh = pm->height();
|
|
} else if ( testf(ExtDev) ) { // external device
|
|
ww = vw = pdev->metric( TQPaintDeviceMetrics::PdmWidth );
|
|
wh = vh = pdev->metric( TQPaintDeviceMetrics::PdmHeight );
|
|
}
|
|
if ( ww == 0 )
|
|
ww = wh = vw = vh = 1024;
|
|
if ( copyFrom ) { // copy redirected widget
|
|
cfont = copyFrom->font();
|
|
cpen = TQPen( copyFrom->foregroundColor() );
|
|
bg_col = copyFrom->backgroundColor();
|
|
}
|
|
if ( testf(ExtDev) ) { // external device
|
|
setBackgroundColor( bg_col ); // default background color
|
|
setBackgroundMode( TransparentMode ); // default background mode
|
|
setRasterOp( CopyROP ); // default raster operation
|
|
}
|
|
clip_serial = gc_cache_clip_serial++;
|
|
updateBrush();
|
|
updatePen();
|
|
return TRUE;
|
|
}
|
|
|
|
/*!
|
|
Ends painting. Any resources used while painting are released.
|
|
|
|
Note that while you mostly don't need to call end(), the
|
|
destructor will do it, there is at least one common case when it
|
|
is needed, namely double buffering.
|
|
|
|
\code
|
|
TQPainter p( myPixmap, this )
|
|
// ...
|
|
p.end(); // stops drawing on myPixmap
|
|
p.begin( this );
|
|
p.drawPixmap( 0, 0, myPixmap );
|
|
\endcode
|
|
|
|
Since you can't draw a TQPixmap while it is being painted, it is
|
|
necessary to close the active painter.
|
|
|
|
\sa begin(), isActive()
|
|
*/
|
|
|
|
bool TQPainter::end() // end painting
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::end: Missing begin() or begin() failed" );
|
|
#endif
|
|
return FALSE;
|
|
}
|
|
killPStack();
|
|
|
|
//#### This should not be necessary:
|
|
if ( pdev->devType() == TQInternal::Widget && // #####
|
|
((TQWidget*)pdev)->testWFlags(WPaintUnclipped) ) {
|
|
if ( gc )
|
|
XSetSubwindowMode( dpy, gc, ClipByChildren );
|
|
if ( gc_brush )
|
|
XSetSubwindowMode( dpy, gc_brush, ClipByChildren );
|
|
}
|
|
|
|
if ( gc_brush ) { // restore brush gc
|
|
if ( brushRef ) {
|
|
release_gc( brushRef );
|
|
brushRef = 0;
|
|
} else {
|
|
free_gc( dpy, gc_brush, testf(UsePrivateCx) );
|
|
}
|
|
gc_brush = 0;
|
|
|
|
}
|
|
if ( gc ) { // restore pen gc
|
|
if ( penRef ) {
|
|
release_gc( penRef );
|
|
penRef = 0;
|
|
} else {
|
|
free_gc( dpy, gc, testf(UsePrivateCx) );
|
|
}
|
|
gc = 0;
|
|
}
|
|
|
|
if ( testf(ExtDev) )
|
|
pdev->cmd( TQPaintDevice::PdcEnd, this, 0 );
|
|
|
|
#ifndef QT_NO_XFTFREETYPE
|
|
if (rendhd) {
|
|
// reset clipping/subwindow mode on our render picture
|
|
XftDrawSetClip((XftDraw *) rendhd, None);
|
|
XftDrawSetSubwindowMode((XftDraw *) rendhd, ClipByChildren);
|
|
}
|
|
#endif // QT_NO_XFTFREETYPE
|
|
|
|
if ( pfont ) {
|
|
delete pfont;
|
|
pfont = 0;
|
|
}
|
|
|
|
flags = 0;
|
|
pdev->painters--;
|
|
pdev = 0;
|
|
dpy = 0;
|
|
return TRUE;
|
|
}
|
|
|
|
/*!
|
|
Flushes any buffered drawing operations inside the region \a
|
|
region using clipping mode \a cm.
|
|
|
|
The flush may update the whole device if the platform does not
|
|
support flushing to a specified region.
|
|
|
|
\sa flush() CoordinateMode
|
|
*/
|
|
|
|
void TQPainter::flush(const TQRegion &rgn, CoordinateMode m)
|
|
{
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[2];
|
|
param[0].rgn = &rgn;
|
|
param[1].ival = m;
|
|
pdev->cmd( TQPaintDevice::PdcFlushRegion, this, param );
|
|
return;
|
|
}
|
|
|
|
flush();
|
|
}
|
|
|
|
|
|
/*!
|
|
\overload
|
|
|
|
Flushes any buffered drawing operations.
|
|
*/
|
|
|
|
void TQPainter::flush()
|
|
{
|
|
if ( testf(ExtDev) ) {
|
|
pdev->cmd( TQPaintDevice::PdcFlush, this, 0 );
|
|
return;
|
|
}
|
|
|
|
if ( isActive() && dpy )
|
|
XFlush( dpy );
|
|
}
|
|
|
|
|
|
/*!
|
|
Sets the background color of the painter to \a c.
|
|
|
|
The background color is the color that is filled in when drawing
|
|
opaque text, stippled lines and bitmaps. The background color has
|
|
no effect in transparent background mode (which is the default).
|
|
|
|
\sa backgroundColor() setBackgroundMode() BackgroundMode
|
|
*/
|
|
|
|
void TQPainter::setBackgroundColor( const TQColor &c )
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::setBackgroundColor: Call begin() first" );
|
|
#endif
|
|
return;
|
|
}
|
|
bg_col = c;
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].color = &bg_col;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetBkColor, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( !penRef )
|
|
updatePen(); // update pen setting
|
|
if ( !brushRef )
|
|
updateBrush(); // update brush setting
|
|
}
|
|
|
|
/*!
|
|
Sets the background mode of the painter to \a m, which must be
|
|
either \c TransparentMode (the default) or \c OpaqueMode.
|
|
|
|
Transparent mode draws stippled lines and text without setting the
|
|
background pixels. Opaque mode fills these space with the current
|
|
background color.
|
|
|
|
Note that in order to draw a bitmap or pixmap transparently, you
|
|
must use TQPixmap::setMask().
|
|
|
|
\sa backgroundMode(), setBackgroundColor()
|
|
*/
|
|
|
|
void TQPainter::setBackgroundMode( BGMode m )
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::setBackgroundMode: Call begin() first" );
|
|
#endif
|
|
return;
|
|
}
|
|
if ( m != TransparentMode && m != OpaqueMode ) {
|
|
#if defined(QT_CHECK_RANGE)
|
|
tqWarning( "TQPainter::setBackgroundMode: Invalid mode" );
|
|
#endif
|
|
return;
|
|
}
|
|
bg_mode = m;
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].ival = m;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetBkMode, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( !penRef )
|
|
updatePen(); // update pen setting
|
|
if ( !brushRef )
|
|
updateBrush(); // update brush setting
|
|
}
|
|
|
|
static const short ropCodes[] = { // ROP translation table
|
|
GXcopy, // CopyROP
|
|
GXor, // OrROP
|
|
GXxor, // XorROP
|
|
GXandInverted, // NotAndROP EraseROP
|
|
GXcopyInverted, // NotCopyROP
|
|
GXorInverted, // NotOrROP
|
|
GXequiv, // NotXorROP
|
|
GXand, // AndROP
|
|
GXinvert, // NotROP
|
|
GXclear, // ClearROP
|
|
GXset, // SetROP
|
|
GXnoop, // NopROP
|
|
GXandReverse, // AndNotROP
|
|
GXorReverse, // OrNotROP
|
|
GXnand, // NandROP
|
|
GXnor // NorROP
|
|
};
|
|
|
|
|
|
/*!
|
|
Sets the \link TQt::RasterOp raster operation \endlink to \a r.
|
|
The default is \c CopyROP.
|
|
|
|
\sa rasterOp() TQt::RasterOp
|
|
*/
|
|
|
|
void TQPainter::setRasterOp( RasterOp r )
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::setRasterOp: Call begin() first" );
|
|
#endif
|
|
return;
|
|
}
|
|
if ( (uint)r > LastROP ) {
|
|
#if defined(QT_CHECK_RANGE)
|
|
tqWarning( "TQPainter::setRasterOp: Invalid ROP code" );
|
|
#endif
|
|
return;
|
|
}
|
|
rop = r;
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].ival = r;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetROP, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( penRef )
|
|
updatePen(); // get non-cached pen GC
|
|
if ( brushRef )
|
|
updateBrush(); // get non-cached brush GC
|
|
XSetFunction( dpy, gc, ropCodes[rop] );
|
|
XSetFunction( dpy, gc_brush, ropCodes[rop] );
|
|
}
|
|
|
|
// ### matthias - true?
|
|
|
|
/*!
|
|
Sets the brush origin to \a (x, y).
|
|
|
|
The brush origin specifies the (0, 0) coordinate of the painter's
|
|
brush. This setting only applies to pattern brushes and pixmap
|
|
brushes.
|
|
|
|
\sa brushOrigin()
|
|
*/
|
|
|
|
void TQPainter::setBrushOrigin( int x, int y )
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::setBrushOrigin: Call begin() first" );
|
|
#endif
|
|
return;
|
|
}
|
|
bro = TQPoint(x, y);
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].point = &bro;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetBrushOrigin, this, param ) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( brushRef )
|
|
updateBrush(); // get non-cached brush GC
|
|
XSetTSOrigin( dpy, gc_brush, x, y );
|
|
}
|
|
|
|
|
|
/*!
|
|
Enables clipping if \a enable is TRUE, or disables clipping if \a
|
|
enable is FALSE.
|
|
|
|
\sa hasClipping(), setClipRect(), setClipRegion()
|
|
*/
|
|
|
|
void TQPainter::setClipping( bool enable )
|
|
{
|
|
if ( !isActive() ) {
|
|
#if defined(QT_CHECK_STATE)
|
|
tqWarning( "TQPainter::setClipping: Will be reset by begin()" );
|
|
#endif
|
|
return;
|
|
}
|
|
|
|
if ( enable == testf(ClipOn) )
|
|
return;
|
|
|
|
setf( ClipOn, enable );
|
|
if ( testf(ExtDev) ) {
|
|
if ( block_ext )
|
|
return;
|
|
TQPDevCmdParam param[1];
|
|
param[0].ival = enable;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetClip, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( enable ) {
|
|
TQRegion rgn = crgn;
|
|
if ( pdev == paintEventDevice && paintEventClipRegion )
|
|
rgn = rgn.intersect( *paintEventClipRegion );
|
|
if ( penRef )
|
|
updatePen();
|
|
if ( brushRef )
|
|
updateBrush();
|
|
x11SetClipRegion( dpy, gc, gc_brush, rendhd, rgn );
|
|
} else {
|
|
if ( pdev == paintEventDevice && paintEventClipRegion ) {
|
|
x11SetClipRegion( dpy, gc, gc_brush , rendhd, *paintEventClipRegion );
|
|
} else {
|
|
x11ClearClipRegion(dpy, gc, gc_brush, rendhd);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
/*!
|
|
\overload
|
|
|
|
Sets the clip region to the rectangle \a r and enables clipping.
|
|
The clip mode is set to \a m.
|
|
|
|
\sa CoordinateMode
|
|
*/
|
|
|
|
void TQPainter::setClipRect( const TQRect &r, CoordinateMode m )
|
|
{
|
|
setClipRegion( TQRegion( r ), m );
|
|
}
|
|
|
|
/*!
|
|
Sets the clip region to \a rgn and enables clipping. The clip mode
|
|
is set to \a m.
|
|
|
|
Note that the clip region is given in physical device coordinates
|
|
and \e not subject to any \link coordsys.html coordinate
|
|
transformation.\endlink
|
|
|
|
\sa setClipRect(), clipRegion(), setClipping() CoordinateMode
|
|
*/
|
|
|
|
void TQPainter::setClipRegion( const TQRegion &rgn, CoordinateMode m )
|
|
{
|
|
#if defined(QT_CHECK_STATE)
|
|
if ( !isActive() )
|
|
tqWarning( "TQPainter::setClipRegion: Will be reset by begin()" );
|
|
#endif
|
|
if ( m == CoordDevice )
|
|
crgn = rgn;
|
|
else
|
|
crgn = xmat * rgn;
|
|
|
|
if ( testf(ExtDev) ) {
|
|
if ( block_ext )
|
|
return;
|
|
TQPDevCmdParam param[2];
|
|
param[0].rgn = &rgn;
|
|
param[1].ival = m;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcSetClipRegion, this, param ) )
|
|
return; // device cannot clip
|
|
}
|
|
clearf( ClipOn ); // be sure to update clip rgn
|
|
setClipping( TRUE );
|
|
}
|
|
|
|
|
|
/*!
|
|
\internal
|
|
|
|
Internal function for drawing a polygon.
|
|
*/
|
|
|
|
void TQPainter::drawPolyInternal( const TQPointArray &a, bool close )
|
|
{
|
|
if ( a.size() < 2 )
|
|
return;
|
|
|
|
int x1, y1, x2, y2; // connect last to first point
|
|
a.point( a.size()-1, &x1, &y1 );
|
|
a.point( 0, &x2, &y2 );
|
|
bool do_close = close && !(x1 == x2 && y1 == y2);
|
|
|
|
if ( close && cbrush.style() != NoBrush ) { // draw filled polygon
|
|
XFillPolygon( dpy, hd, gc_brush, (XPoint*)a.shortPoints(), a.size(),
|
|
Nonconvex, CoordModeOrigin );
|
|
if ( cpen.style() == NoPen ) { // draw fake outline
|
|
XDrawLines( dpy, hd, gc_brush, (XPoint*)a.shortPoints(), a.size(),
|
|
CoordModeOrigin );
|
|
if ( do_close )
|
|
XDrawLine( dpy, hd, gc_brush, x1, y1, x2, y2 );
|
|
}
|
|
}
|
|
if ( cpen.style() != NoPen ) { // draw outline
|
|
XDrawLines( dpy, hd, gc, (XPoint*)a.shortPoints(), a.size(),
|
|
CoordModeOrigin);
|
|
if ( do_close )
|
|
XDrawLine( dpy, hd, gc, x1, y1, x2, y2 );
|
|
}
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws/plots a single point at \a (x, y) using the current pen.
|
|
|
|
\sa TQPen
|
|
*/
|
|
|
|
void TQPainter::drawPoint( int x, int y )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQPoint p( x, y );
|
|
param[0].point = &p;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawPoint, this, param ) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
map( x, y, &x, &y );
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawPoint( dpy, hd, gc, x, y );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws/plots an array of points, \a a, using the current pen.
|
|
|
|
If \a index is non-zero (the default is zero) only points from \a
|
|
index are drawn. If \a npoints is negative (the default) the rest
|
|
of the points from \a index are drawn. If \a npoints is zero or
|
|
greater, \a npoints points are drawn.
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
*/
|
|
|
|
void TQPainter::drawPoints( const TQPointArray& a, int index, int npoints )
|
|
{
|
|
if ( npoints < 0 )
|
|
npoints = a.size() - index;
|
|
if ( index + npoints > (int)a.size() )
|
|
npoints = a.size() - index;
|
|
if ( !isActive() || npoints < 1 || index < 0 )
|
|
return;
|
|
TQPointArray pa = a;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
for (int i=0; i<npoints; i++) {
|
|
TQPoint p( pa[index+i].x(), pa[index+i].y() );
|
|
param[0].point = &p;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawPoint, this, param ))
|
|
return;
|
|
}
|
|
if ( !hd ) return;
|
|
}
|
|
if ( txop != TxNone ) {
|
|
pa = xForm( a, index, npoints );
|
|
if ( pa.size() != a.size() ) {
|
|
index = 0;
|
|
npoints = pa.size();
|
|
}
|
|
}
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawPoints( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
|
|
npoints, CoordModeOrigin );
|
|
}
|
|
|
|
|
|
/*! \obsolete
|
|
Sets the current pen position to \a (x, y)
|
|
|
|
\sa lineTo(), pos()
|
|
*/
|
|
|
|
void TQPainter::moveTo( int x, int y )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQPoint p( x, y );
|
|
param[0].point = &p;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcMoveTo, this, param ) || !hd )
|
|
return;
|
|
}
|
|
}
|
|
curPt = TQPoint( x, y );
|
|
}
|
|
|
|
/*! \obsolete
|
|
Use drawLine() instead.
|
|
|
|
Draws a line from the current pen position to \a (x, y) and sets
|
|
\a (x, y) to be the new current pen position.
|
|
|
|
\sa TQPen moveTo(), drawLine(), pos()
|
|
*/
|
|
|
|
void TQPainter::lineTo( int x, int y )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
int cx = curPt.x(), cy = curPt.y();
|
|
curPt = TQPoint( x, y );
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQPoint p( x, y );
|
|
param[0].point = &p;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcLineTo, this, param ) || !hd )
|
|
return;
|
|
}
|
|
map( x, y, &x, &y );
|
|
map( cx, cy, &cx, &cy );
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawLine( dpy, hd, gc, cx, cy, x, y );
|
|
}
|
|
|
|
/*!
|
|
Draws a line from (\a x1, \a y1) to (\a x2, \a y2) and sets the
|
|
current pen position to (\a x2, \a y2).
|
|
|
|
\sa pen()
|
|
*/
|
|
|
|
void TQPainter::drawLine( int x1, int y1, int x2, int y2 )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
curPt = TQPoint( x2, y2 );
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[2];
|
|
TQPoint p1(x1, y1), p2(x2, y2);
|
|
param[0].point = &p1;
|
|
param[1].point = &p2;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawLine, this, param ) || !hd )
|
|
return;
|
|
}
|
|
map( x1, y1, &x1, &y1 );
|
|
map( x2, y2, &x2, &y2 );
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawLine( dpy, hd, gc, x1, y1, x2, y2 );
|
|
}
|
|
|
|
|
|
|
|
/*!
|
|
Draws a rectangle with upper left corner at \a (x, y) and with
|
|
width \a w and height \a h.
|
|
|
|
\sa TQPen, drawRoundRect()
|
|
*/
|
|
|
|
void TQPainter::drawRect( int x, int y, int w, int h )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawRect, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear polygon
|
|
TQPointArray pa = xmat.mapToPolygon( TQRect(x, y, w, h) );
|
|
pa.resize( 5 );
|
|
pa.setPoint( 4, pa.point( 0 ) );
|
|
drawPolyInternal( pa );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
if ( cbrush.style() != NoBrush ) {
|
|
if ( cpen.style() == NoPen ) {
|
|
XFillRectangle( dpy, hd, gc_brush, x, y, w, h );
|
|
return;
|
|
}
|
|
int lw = cpen.width();
|
|
int lw2 = (lw+1)/2;
|
|
if ( w > lw && h > lw )
|
|
XFillRectangle( dpy, hd, gc_brush, x+lw2, y+lw2, w-lw-1, h-lw-1 );
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawRectangle( dpy, hd, gc, x, y, w-1, h-1 );
|
|
}
|
|
|
|
/*!
|
|
\overload
|
|
|
|
Draws a Windows focus rectangle with upper left corner at (\a x,
|
|
\a y) and with width \a w and height \a h.
|
|
|
|
This function draws a stippled XOR rectangle that is used to
|
|
indicate keyboard focus (when TQApplication::style() is \c
|
|
WindowStyle).
|
|
|
|
\warning This function draws nothing if the coordinate system has
|
|
been \link rotate() rotated\endlink or \link shear()
|
|
sheared\endlink.
|
|
|
|
\sa drawRect(), TQApplication::style()
|
|
*/
|
|
|
|
void TQPainter::drawWinFocusRect( int x, int y, int w, int h )
|
|
{
|
|
drawWinFocusRect( x, y, w, h, TRUE, color0 );
|
|
}
|
|
|
|
/*!
|
|
Draws a Windows focus rectangle with upper left corner at (\a x,
|
|
\a y) and with width \a w and height \a h using a pen color that
|
|
contrasts with \a bgColor.
|
|
|
|
This function draws a stippled rectangle (XOR is not used) that is
|
|
used to indicate keyboard focus (when the TQApplication::style() is
|
|
\c WindowStyle).
|
|
|
|
The pen color used to draw the rectangle is either white or black
|
|
depending on the color of \a bgColor (see TQColor::gray()).
|
|
|
|
\warning This function draws nothing if the coordinate system has
|
|
been \link rotate() rotated\endlink or \link shear()
|
|
sheared\endlink.
|
|
|
|
\sa drawRect(), TQApplication::style()
|
|
*/
|
|
|
|
void TQPainter::drawWinFocusRect( int x, int y, int w, int h,
|
|
const TQColor &bgColor )
|
|
{
|
|
drawWinFocusRect( x, y, w, h, FALSE, bgColor );
|
|
}
|
|
|
|
|
|
/*!
|
|
\internal
|
|
*/
|
|
|
|
void TQPainter::drawWinFocusRect( int x, int y, int w, int h,
|
|
bool xorPaint, const TQColor &bgColor )
|
|
{
|
|
if ( !isActive() || txop == TxRotShear )
|
|
return;
|
|
static char winfocus_line[] = { 1, 1 };
|
|
|
|
TQPen old_pen = cpen;
|
|
TQBrush old_brush = cbrush;
|
|
RasterOp old_rop = (RasterOp)rop;
|
|
|
|
if ( xorPaint ) {
|
|
if ( TQColor::numBitPlanes() <= 8 ) {
|
|
setPen( TQPen(color1, 0, TQt::FineDotLine) );
|
|
}
|
|
else if ( TQColor::numBitPlanes() <= 8 ) {
|
|
setPen( TQPen(white, 0, TQt::FineDotLine) );
|
|
}
|
|
else {
|
|
setPen( TQPen(TQColor(tqRgba(255,255,255,0)), 0, TQt::FineDotLine) );
|
|
}
|
|
setRasterOp( XorROP );
|
|
}
|
|
else {
|
|
if ( tqGray( bgColor.rgb() ) < 128 ) {
|
|
setPen( TQPen(white, 0, TQt::FineDotLine) );
|
|
}
|
|
else {
|
|
setPen( TQPen(black, 0, TQt::FineDotLine) );
|
|
}
|
|
}
|
|
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQRect r( x, y, w-1, h-1 );
|
|
TQBrush noBrush;
|
|
setBrush( noBrush );
|
|
param[0].rect = &r;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawRect, this, param ) || !hd) {
|
|
setRasterOp( old_rop );
|
|
setPen( old_pen );
|
|
setBrush( old_brush );
|
|
return;
|
|
}
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
XSetDashes( dpy, gc, 0, winfocus_line, 2 );
|
|
XSetLineAttributes( dpy, gc, 1, LineOnOffDash, CapButt, JoinMiter );
|
|
|
|
XDrawRectangle( dpy, hd, gc, x, y, w-1, h-1 );
|
|
|
|
XSetLineAttributes( dpy, gc, 0, LineSolid, CapButt, JoinMiter );
|
|
setRasterOp( old_rop );
|
|
setPen( old_pen );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws a rectangle with rounded corners at \a (x, y), with width \a
|
|
w and height \a h.
|
|
|
|
The \a xRnd and \a yRnd arguments specify how rounded the corners
|
|
should be. 0 is angled corners, 99 is maximum roundedness.
|
|
|
|
The width and height include all of the drawn lines.
|
|
|
|
\sa drawRect(), TQPen
|
|
*/
|
|
|
|
void TQPainter::drawRoundRect( int x, int y, int w, int h, int xRnd, int yRnd )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( xRnd <= 0 || yRnd <= 0 ) {
|
|
drawRect( x, y, w, h ); // draw normal rectangle
|
|
return;
|
|
}
|
|
if ( xRnd >= 100 ) // fix ranges
|
|
xRnd = 99;
|
|
if ( yRnd >= 100 )
|
|
yRnd = 99;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[3];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
param[1].ival = xRnd;
|
|
param[2].ival = yRnd;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawRoundRect, this, param ) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear polygon
|
|
if ( w <= 0 || h <= 0 )
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
w--;
|
|
h--;
|
|
int rxx = w*xRnd/200;
|
|
int ryy = h*yRnd/200;
|
|
// were there overflows?
|
|
if ( rxx < 0 )
|
|
rxx = w/200*xRnd;
|
|
if ( ryy < 0 )
|
|
ryy = h/200*yRnd;
|
|
int rxx2 = 2*rxx;
|
|
int ryy2 = 2*ryy;
|
|
TQPointArray a[4];
|
|
a[0].makeArc( x, y, rxx2, ryy2, 1*16*90, 16*90, xmat );
|
|
a[1].makeArc( x, y+h-ryy2, rxx2, ryy2, 2*16*90, 16*90, xmat );
|
|
a[2].makeArc( x+w-rxx2, y+h-ryy2, rxx2, ryy2, 3*16*90, 16*90, xmat );
|
|
a[3].makeArc( x+w-rxx2, y, rxx2, ryy2, 0*16*90, 16*90, xmat );
|
|
// ### is there a better way to join TQPointArrays?
|
|
TQPointArray aa;
|
|
aa.resize( a[0].size() + a[1].size() + a[2].size() + a[3].size() );
|
|
uint j = 0;
|
|
for ( int k=0; k<4; k++ ) {
|
|
for ( uint i=0; i<a[k].size(); i++ ) {
|
|
aa.setPoint( j, a[k].point(i) );
|
|
j++;
|
|
}
|
|
}
|
|
drawPolyInternal( aa );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
w--;
|
|
h--;
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
int rx = (w*xRnd)/200;
|
|
int ry = (h*yRnd)/200;
|
|
int rx2 = 2*rx;
|
|
int ry2 = 2*ry;
|
|
if ( cbrush.style() != NoBrush ) { // draw filled round rect
|
|
int dp, ds;
|
|
if ( cpen.style() == NoPen ) {
|
|
dp = 0;
|
|
ds = 1;
|
|
}
|
|
else {
|
|
dp = 1;
|
|
ds = 0;
|
|
}
|
|
#define SET_ARC(px, py, w, h, a1, a2) \
|
|
a->x=px; a->y=py; a->width=w; a->height=h; a->angle1=a1; a->angle2=a2; a++
|
|
XArc arcs[4];
|
|
XArc *a = arcs;
|
|
SET_ARC( x+w-rx2, y, rx2, ry2, 0, 90*64 );
|
|
SET_ARC( x, y, rx2, ry2, 90*64, 90*64 );
|
|
SET_ARC( x, y+h-ry2, rx2, ry2, 180*64, 90*64 );
|
|
SET_ARC( x+w-rx2, y+h-ry2, rx2, ry2, 270*64, 90*64 );
|
|
XFillArcs( dpy, hd, gc_brush, arcs, 4 );
|
|
#undef SET_ARC
|
|
#define SET_RCT(px, py, w, h) \
|
|
r->x=px; r->y=py; r->width=w; r->height=h; r++
|
|
XRectangle rects[3];
|
|
XRectangle *r = rects;
|
|
SET_RCT( x+rx, y+dp, w-rx2, ry );
|
|
SET_RCT( x+dp, y+ry, w+ds, h-ry2 );
|
|
SET_RCT( x+rx, y+h-ry, w-rx2, ry+ds );
|
|
XFillRectangles( dpy, hd, gc_brush, rects, 3 );
|
|
#undef SET_RCT
|
|
}
|
|
if ( cpen.style() != NoPen ) { // draw outline
|
|
#define SET_ARC(px, py, w, h, a1, a2) \
|
|
a->x=px; a->y=py; a->width=w; a->height=h; a->angle1=a1; a->angle2=a2; a++
|
|
XArc arcs[4];
|
|
XArc *a = arcs;
|
|
SET_ARC( x+w-rx2, y, rx2, ry2, 0, 90*64 );
|
|
SET_ARC( x, y, rx2, ry2, 90*64, 90*64 );
|
|
SET_ARC( x, y+h-ry2, rx2, ry2, 180*64, 90*64 );
|
|
SET_ARC( x+w-rx2, y+h-ry2, rx2, ry2, 270*64, 90*64 );
|
|
XDrawArcs( dpy, hd, gc, arcs, 4 );
|
|
#undef SET_ARC
|
|
#define SET_SEG(xp1, yp1, xp2, yp2) \
|
|
s->x1=xp1; s->y1=yp1; s->x2=xp2; s->y2=yp2; s++
|
|
XSegment segs[4];
|
|
XSegment *s = segs;
|
|
SET_SEG( x+rx, y, x+w-rx, y );
|
|
SET_SEG( x+rx, y+h, x+w-rx, y+h );
|
|
SET_SEG( x, y+ry, x, y+h-ry );
|
|
SET_SEG( x+w, y+ry, x+w, y+h-ry );
|
|
XDrawSegments( dpy, hd, gc, segs, 4 );
|
|
#undef SET_SET
|
|
}
|
|
}
|
|
|
|
/*!
|
|
Draws an ellipse with center at \a (x + w/2, y + h/2) and size \a
|
|
(w, h).
|
|
*/
|
|
|
|
void TQPainter::drawEllipse( int x, int y, int w, int h )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawEllipse, this, param ) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear polygon
|
|
TQPointArray a;
|
|
a.makeArc( x, y, w, h, 0, 360*16, xmat );
|
|
drawPolyInternal( a );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
if ( w == 1 && h == 1 ) {
|
|
XDrawPoint( dpy, hd, (cpen.style() == NoPen)?gc_brush:gc, x, y );
|
|
return;
|
|
}
|
|
w--;
|
|
h--;
|
|
if ( cbrush.style() != NoBrush ) { // draw filled ellipse
|
|
XFillArc( dpy, hd, gc_brush, x, y, w, h, 0, 360*64 );
|
|
if ( cpen.style() == NoPen ) {
|
|
XDrawArc( dpy, hd, gc_brush, x, y, w, h, 0, 360*64 );
|
|
return;
|
|
}
|
|
}
|
|
if ( cpen.style() != NoPen ) // draw outline
|
|
XDrawArc( dpy, hd, gc, x, y, w, h, 0, 360*64 );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws an arc defined by the rectangle \a (x, y, w, h), the start
|
|
angle \a a and the arc length \a alen.
|
|
|
|
The angles \a a and \a alen are 1/16th of a degree, i.e. a full
|
|
circle equals 5760 (16*360). Positive values of \a a and \a alen
|
|
mean counter-clockwise while negative values mean the clockwise
|
|
direction. Zero degrees is at the 3 o'clock position.
|
|
|
|
Example:
|
|
\code
|
|
TQPainter p( myWidget );
|
|
p.drawArc( 10,10, 70,100, 100*16, 160*16 ); // draws a "(" arc
|
|
\endcode
|
|
|
|
\sa drawPie(), drawChord()
|
|
*/
|
|
|
|
void TQPainter::drawArc( int x, int y, int w, int h, int a, int alen )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[3];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
param[1].ival = a;
|
|
param[2].ival = alen;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawArc, this, param ) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear
|
|
TQPointArray pa;
|
|
pa.makeArc( x, y, w, h, a, alen, xmat ); // arc polyline
|
|
drawPolyInternal( pa, FALSE );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
w--;
|
|
h--;
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawArc( dpy, hd, gc, x, y, w, h, a*4, alen*4 );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws a pie defined by the rectangle \a (x, y, w, h), the start
|
|
angle \a a and the arc length \a alen.
|
|
|
|
The pie is filled with the current brush().
|
|
|
|
The angles \a a and \a alen are 1/16th of a degree, i.e. a full
|
|
circle equals 5760 (16*360). Positive values of \a a and \a alen
|
|
mean counter-clockwise while negative values mean the clockwise
|
|
direction. Zero degrees is at the 3 o'clock position.
|
|
|
|
\sa drawArc(), drawChord()
|
|
*/
|
|
|
|
void TQPainter::drawPie( int x, int y, int w, int h, int a, int alen )
|
|
{
|
|
// Make sure "a" is 0..360*16, as otherwise a*4 may overflow 16 bits.
|
|
if ( a > (360*16) ) {
|
|
a = a % (360*16);
|
|
} else if ( a < 0 ) {
|
|
a = a % (360*16);
|
|
if ( a < 0 ) a += (360*16);
|
|
}
|
|
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[3];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
param[1].ival = a;
|
|
param[2].ival = alen;
|
|
if ( !pdev->cmd( TQPaintDevice::PdcDrawPie, this, param ) || !hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear
|
|
TQPointArray pa;
|
|
pa.makeArc( x, y, w, h, a, alen, xmat ); // arc polyline
|
|
int n = pa.size();
|
|
int cx, cy;
|
|
xmat.map(x+w/2, y+h/2, &cx, &cy);
|
|
pa.resize( n+2 );
|
|
pa.setPoint( n, cx, cy ); // add legs
|
|
pa.setPoint( n+1, pa.at(0) );
|
|
drawPolyInternal( pa );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
XSetArcMode( dpy, gc_brush, ArcPieSlice );
|
|
w--;
|
|
h--;
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
|
|
GC g = gc;
|
|
bool nopen = cpen.style() == NoPen;
|
|
|
|
if ( cbrush.style() != NoBrush ) { // draw filled pie
|
|
XFillArc( dpy, hd, gc_brush, x, y, w, h, a*4, alen*4 );
|
|
if ( nopen ) {
|
|
g = gc_brush;
|
|
nopen = FALSE;
|
|
}
|
|
}
|
|
if ( !nopen ) { // draw pie outline
|
|
double w2 = 0.5*w; // with, height in ellipsis
|
|
double h2 = 0.5*h;
|
|
double xc = (double)x+w2;
|
|
double yc = (double)y+h2;
|
|
double ra1 = Q_PI/2880.0*a; // convert a, alen to radians
|
|
double ra2 = ra1 + Q_PI/2880.0*alen;
|
|
int xic = tqRound(xc);
|
|
int yic = tqRound(yc);
|
|
XDrawLine( dpy, hd, g, xic, yic,
|
|
tqRound(xc + qcos(ra1)*w2), tqRound(yc - qsin(ra1)*h2));
|
|
XDrawLine( dpy, hd, g, xic, yic,
|
|
tqRound(xc + qcos(ra2)*w2), tqRound(yc - qsin(ra2)*h2));
|
|
XDrawArc( dpy, hd, g, x, y, w, h, a*4, alen*4 );
|
|
}
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws a chord defined by the rectangle \a (x, y, w, h), the start
|
|
angle \a a and the arc length \a alen.
|
|
|
|
The chord is filled with the current brush().
|
|
|
|
The angles \a a and \a alen are 1/16th of a degree, i.e. a full
|
|
circle equals 5760 (16*360). Positive values of \a a and \a alen
|
|
mean counter-clockwise while negative values mean the clockwise
|
|
direction. Zero degrees is at the 3 o'clock position.
|
|
|
|
\sa drawArc(), drawPie()
|
|
*/
|
|
|
|
void TQPainter::drawChord( int x, int y, int w, int h, int a, int alen )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[3];
|
|
TQRect r( x, y, w, h );
|
|
param[0].rect = &r;
|
|
param[1].ival = a;
|
|
param[2].ival = alen;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawChord, this, param) || !hd )
|
|
return;
|
|
}
|
|
if ( txop == TxRotShear ) { // rotate/shear
|
|
TQPointArray pa;
|
|
pa.makeArc( x, y, w-1, h-1, a, alen, xmat ); // arc polygon
|
|
int n = pa.size();
|
|
pa.resize( n+1 );
|
|
pa.setPoint( n, pa.at(0) ); // connect endpoints
|
|
drawPolyInternal( pa );
|
|
return;
|
|
}
|
|
map( x, y, w, h, &x, &y, &w, &h );
|
|
}
|
|
XSetArcMode( dpy, gc_brush, ArcChord );
|
|
w--;
|
|
h--;
|
|
if ( w <= 0 || h <= 0 ) {
|
|
if ( w == 0 || h == 0 )
|
|
return;
|
|
fix_neg_rect( &x, &y, &w, &h );
|
|
}
|
|
|
|
GC g = gc;
|
|
bool nopen = cpen.style() == NoPen;
|
|
|
|
if ( cbrush.style() != NoBrush ) { // draw filled chord
|
|
XFillArc( dpy, hd, gc_brush, x, y, w, h, a*4, alen*4 );
|
|
if ( nopen ) {
|
|
g = gc_brush;
|
|
nopen = FALSE;
|
|
}
|
|
}
|
|
if ( !nopen ) { // draw chord outline
|
|
double w2 = 0.5*w; // with, height in ellipsis
|
|
double h2 = 0.5*h;
|
|
double xc = (double)x+w2;
|
|
double yc = (double)y+h2;
|
|
double ra1 = Q_PI/2880.0*a; // convert a, alen to radians
|
|
double ra2 = ra1 + Q_PI/2880.0*alen;
|
|
XDrawLine( dpy, hd, g,
|
|
tqRound(xc + qcos(ra1)*w2), tqRound(yc - qsin(ra1)*h2),
|
|
tqRound(xc + qcos(ra2)*w2), tqRound(yc - qsin(ra2)*h2));
|
|
XDrawArc( dpy, hd, g, x, y, w, h, a*4, alen*4 );
|
|
}
|
|
XSetArcMode( dpy, gc_brush, ArcPieSlice );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws \a nlines separate lines from points defined in \a a,
|
|
starting at \a a[index] (\a index defaults to 0). If \a nlines is
|
|
-1 (the default) all points until the end of the array are used
|
|
(i.e. (a.size()-index)/2 lines are drawn).
|
|
|
|
Draws the 1st line from \a a[index] to \a a[index+1]. Draws the
|
|
2nd line from \a a[index+2] to \a a[index+3] etc.
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
|
|
\sa drawPolyline(), drawPolygon(), TQPen
|
|
*/
|
|
|
|
void TQPainter::drawLineSegments( const TQPointArray &a, int index, int nlines )
|
|
{
|
|
if ( nlines < 0 )
|
|
nlines = a.size()/2 - index/2;
|
|
if ( index + nlines*2 > (int)a.size() )
|
|
nlines = (a.size() - index)/2;
|
|
if ( !isActive() || nlines < 1 || index < 0 )
|
|
return;
|
|
TQPointArray pa = a;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
if ( 2*nlines != (int)pa.size() ) {
|
|
pa = TQPointArray( nlines*2 );
|
|
for ( int i=0; i<nlines*2; i++ )
|
|
pa.setPoint( i, a.point(index+i) );
|
|
index = 0;
|
|
}
|
|
TQPDevCmdParam param[1];
|
|
param[0].ptarr = (TQPointArray*)&pa;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawLineSegments, this, param) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( txop != TxNone ) {
|
|
pa = xForm( a, index, nlines*2 );
|
|
if ( pa.size() != a.size() ) {
|
|
index = 0;
|
|
nlines = pa.size()/2;
|
|
}
|
|
}
|
|
}
|
|
if ( cpen.style() != NoPen )
|
|
XDrawSegments( dpy, hd, gc,
|
|
(XSegment*)(pa.shortPoints( index, nlines*2 )), nlines );
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws the polyline defined by the \a npoints points in \a a
|
|
starting at \a a[index]. (\a index defaults to 0.)
|
|
|
|
If \a npoints is -1 (the default) all points until the end of the
|
|
array are used (i.e. a.size()-index-1 line segments are drawn).
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
|
|
\sa drawLineSegments(), drawPolygon(), TQPen
|
|
*/
|
|
|
|
void TQPainter::drawPolyline( const TQPointArray &a, int index, int npoints )
|
|
{
|
|
if ( npoints < 0 )
|
|
npoints = a.size() - index;
|
|
if ( index + npoints > (int)a.size() )
|
|
npoints = a.size() - index;
|
|
if ( !isActive() || npoints < 2 || index < 0 )
|
|
return;
|
|
TQPointArray pa = a;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
if ( npoints != (int)pa.size() ) {
|
|
pa = TQPointArray( npoints );
|
|
for ( int i=0; i<npoints; i++ )
|
|
pa.setPoint( i, a.point(index+i) );
|
|
index = 0;
|
|
}
|
|
TQPDevCmdParam param[1];
|
|
param[0].ptarr = (TQPointArray*)&pa;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawPolyline, this, param) || !hd )
|
|
return;
|
|
}
|
|
if ( txop != TxNone ) {
|
|
pa = xForm( pa, index, npoints );
|
|
if ( pa.size() != a.size() ) {
|
|
index = 0;
|
|
npoints = pa.size();
|
|
}
|
|
}
|
|
}
|
|
if ( cpen.style() != NoPen ) {
|
|
while(npoints>65535) {
|
|
XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, 65535 )),
|
|
65535, CoordModeOrigin );
|
|
npoints-=65535;
|
|
index+=65535;
|
|
}
|
|
XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
|
|
npoints, CoordModeOrigin );
|
|
}
|
|
}
|
|
|
|
static int global_polygon_shape = Complex;
|
|
|
|
/*!
|
|
Draws the polygon defined by the \a npoints points in \a a
|
|
starting at \a a[index]. (\a index defaults to 0.)
|
|
|
|
If \a npoints is -1 (the default) all points until the end of the
|
|
array are used (i.e. a.size()-index line segments define the
|
|
polygon).
|
|
|
|
The first point is always connected to the last point.
|
|
|
|
The polygon is filled with the current brush(). If \a winding is
|
|
TRUE, the polygon is filled using the winding fill algorithm. If
|
|
\a winding is FALSE, the polygon is filled using the even-odd
|
|
(alternative) fill algorithm.
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
|
|
\sa drawLineSegments(), drawPolyline(), TQPen
|
|
*/
|
|
|
|
void TQPainter::drawPolygon( const TQPointArray &a, bool winding,
|
|
int index, int npoints )
|
|
{
|
|
if ( npoints < 0 )
|
|
npoints = a.size() - index;
|
|
if ( index + npoints > (int)a.size() )
|
|
npoints = a.size() - index;
|
|
if ( !isActive() || npoints < 2 || index < 0 )
|
|
return;
|
|
TQPointArray pa = a;
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
if ( npoints != (int)a.size() ) {
|
|
pa = TQPointArray( npoints );
|
|
for ( int i=0; i<npoints; i++ )
|
|
pa.setPoint( i, a.point(index+i) );
|
|
index = 0;
|
|
}
|
|
TQPDevCmdParam param[2];
|
|
param[0].ptarr = (TQPointArray*)&pa;
|
|
param[1].ival = winding;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawPolygon, this, param) || !hd )
|
|
return;
|
|
}
|
|
if ( txop != TxNone ) {
|
|
pa = xForm( a, index, npoints );
|
|
if ( pa.size() != a.size() ) {
|
|
index = 0;
|
|
npoints = pa.size();
|
|
}
|
|
}
|
|
}
|
|
if ( winding ) // set to winding fill rule
|
|
XSetFillRule( dpy, gc_brush, WindingRule );
|
|
|
|
if ( pa[index] != pa[index+npoints-1] ){ // close open pointarray
|
|
pa.detach();
|
|
pa.resize( index+npoints+1 );
|
|
pa.setPoint( index+npoints, pa[index] );
|
|
npoints++;
|
|
}
|
|
|
|
if ( cbrush.style() != NoBrush ) { // draw filled polygon
|
|
XFillPolygon( dpy, hd, gc_brush,
|
|
(XPoint*)(pa.shortPoints( index, npoints )),
|
|
npoints, global_polygon_shape, CoordModeOrigin );
|
|
}
|
|
if ( cpen.style() != NoPen ) { // draw outline
|
|
XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
|
|
npoints, CoordModeOrigin );
|
|
}
|
|
if ( winding ) // set to normal fill rule
|
|
XSetFillRule( dpy, gc_brush, EvenOddRule );
|
|
}
|
|
|
|
/*!
|
|
Draws the convex polygon defined by the \a npoints points in \a pa
|
|
starting at \a pa[index] (\a index defaults to 0).
|
|
|
|
If the supplied polygon is not convex, the results are undefined.
|
|
|
|
On some platforms (e.g. X Window), this is faster than
|
|
drawPolygon().
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
*/
|
|
void TQPainter::drawConvexPolygon( const TQPointArray &pa,
|
|
int index, int npoints )
|
|
{
|
|
global_polygon_shape = Convex;
|
|
drawPolygon(pa, FALSE, index, npoints);
|
|
global_polygon_shape = Complex;
|
|
}
|
|
|
|
|
|
|
|
/*!
|
|
Draws a cubic Bezier curve defined by the control points in \a a,
|
|
starting at \a a[index] (\a index defaults to 0).
|
|
|
|
Control points after \a a[index + 3] are ignored. Nothing happens
|
|
if there aren't enough control points.
|
|
|
|
\warning On X11, coordinates that do not fit into 16-bit signed
|
|
values are truncated. This limitation is expected to go away in
|
|
TQt 4.
|
|
*/
|
|
|
|
void TQPainter::drawCubicBezier( const TQPointArray &a, int index )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if ( a.size() - index < 4 ) {
|
|
#if defined(QT_CHECK_RANGE)
|
|
tqWarning( "TQPainter::drawCubicBezier: Cubic Bezier needs 4 control "
|
|
"points" );
|
|
#endif
|
|
return;
|
|
}
|
|
TQPointArray pa( a );
|
|
if ( index != 0 || a.size() > 4 ) {
|
|
pa = TQPointArray( 4 );
|
|
for ( int i=0; i<4; i++ )
|
|
pa.setPoint( i, a.point(index+i) );
|
|
}
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[1];
|
|
param[0].ptarr = (TQPointArray*)&pa;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawCubicBezier, this, param) ||
|
|
!hd )
|
|
return;
|
|
}
|
|
if ( txop != TxNone )
|
|
pa = xForm( pa );
|
|
}
|
|
if ( cpen.style() != NoPen ) {
|
|
pa = pa.cubicBezier();
|
|
XDrawLines( dpy, hd, gc, (XPoint*)pa.shortPoints(), pa.size(),
|
|
CoordModeOrigin );
|
|
}
|
|
}
|
|
|
|
|
|
/*!
|
|
Draws a pixmap at \a (x, y) by copying a part of \a pixmap into
|
|
the paint device.
|
|
|
|
\a (x, y) specifies the top-left point in the paint device that is
|
|
to be drawn onto. \a (sx, sy) specifies the top-left point in \a
|
|
pixmap that is to be drawn. The default is (0, 0).
|
|
|
|
\a (sw, sh) specifies the size of the pixmap that is to be drawn.
|
|
The default, (-1, -1), means all the way to the bottom right of
|
|
the pixmap.
|
|
|
|
Currently the mask of the pixmap or it's alpha channel are ignored
|
|
when painting on a TQPrinter.
|
|
|
|
\sa bitBlt(), TQPixmap::setMask()
|
|
*/
|
|
|
|
void TQPainter::drawPixmap( int x, int y, const TQPixmap &pixmap,
|
|
int sx, int sy, int sw, int sh )
|
|
{
|
|
if ( !isActive() || pixmap.isNull() )
|
|
return;
|
|
|
|
// right/bottom
|
|
if ( sw < 0 )
|
|
sw = pixmap.width() - sx;
|
|
if ( sh < 0 )
|
|
sh = pixmap.height() - sy;
|
|
|
|
// Sanity-check clipping
|
|
if ( sx < 0 ) {
|
|
x -= sx;
|
|
sw += sx;
|
|
sx = 0;
|
|
}
|
|
if ( sw + sx > pixmap.width() )
|
|
sw = pixmap.width() - sx;
|
|
if ( sy < 0 ) {
|
|
y -= sy;
|
|
sh += sy;
|
|
sy = 0;
|
|
}
|
|
if ( sh + sy > pixmap.height() )
|
|
sh = pixmap.height() - sy;
|
|
|
|
if ( sw <= 0 || sh <= 0 )
|
|
return;
|
|
|
|
if ( pdev->x11Screen() != pixmap.x11Screen() ) {
|
|
TQPixmap* p = (TQPixmap*) &pixmap;
|
|
p->x11SetScreen( pdev->x11Screen() );
|
|
}
|
|
|
|
TQPixmap::x11SetDefaultScreen( pixmap.x11Screen() );
|
|
|
|
if ( testf(ExtDev|VxF|WxF) ) {
|
|
if ( testf(ExtDev) || txop == TxScale || txop == TxRotShear ) {
|
|
if ( sx != 0 || sy != 0 ||
|
|
sw != pixmap.width() || sh != pixmap.height() ) {
|
|
TQPixmap tmp( sw, sh, pixmap.depth() );
|
|
bitBlt( &tmp, 0, 0, &pixmap, sx, sy, sw, sh, CopyROP, TRUE );
|
|
if ( pixmap.mask() ) {
|
|
TQBitmap mask( sw, sh );
|
|
bitBlt( &mask, 0, 0, pixmap.mask(), sx, sy, sw, sh,
|
|
CopyROP, TRUE );
|
|
tmp.setMask( mask );
|
|
}
|
|
drawPixmap( x, y, tmp );
|
|
return;
|
|
}
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[2];
|
|
TQRect r(x, y, pixmap.width(), pixmap.height());
|
|
param[0].rect = &r;
|
|
param[1].pixmap = &pixmap;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawPixmap, this, param) || !hd )
|
|
return;
|
|
}
|
|
if ( txop == TxScale || txop == TxRotShear ) {
|
|
TQWMatrix mat( m11(), m12(),
|
|
m21(), m22(),
|
|
dx(), dy() );
|
|
mat = TQPixmap::trueMatrix( mat, sw, sh );
|
|
TQPixmap pm = pixmap.xForm( mat );
|
|
if ( !pm.mask() && txop == TxRotShear ) {
|
|
TQBitmap bm_clip( sw, sh, 1 );
|
|
bm_clip.fill( color1 );
|
|
pm.setMask( bm_clip.xForm(mat) );
|
|
}
|
|
map( x, y, &x, &y ); // compute position of pixmap
|
|
int dx, dy;
|
|
mat.map( 0, 0, &dx, &dy );
|
|
uint save_flags = flags;
|
|
flags = IsActive | (save_flags & ClipOn);
|
|
drawPixmap( x-dx, y-dy, pm );
|
|
flags = save_flags;
|
|
return;
|
|
}
|
|
}
|
|
map( x, y, &x, &y );
|
|
}
|
|
|
|
TQBitmap *mask = (TQBitmap *)pixmap.mask();
|
|
bool mono = pixmap.depth() == 1;
|
|
|
|
if ( mask && !hasClipping() && pdev != paintEventDevice ) {
|
|
if ( mono ) { // needs GCs pen color
|
|
bool selfmask = pixmap.data->selfmask;
|
|
if ( selfmask ) {
|
|
XSetFillStyle( dpy, gc, FillStippled );
|
|
XSetStipple( dpy, gc, pixmap.handle() );
|
|
} else {
|
|
XSetFillStyle( dpy, gc, FillOpaqueStippled );
|
|
XSetStipple( dpy, gc, pixmap.handle() );
|
|
XSetClipMask( dpy, gc, mask->handle() );
|
|
XSetClipOrigin( dpy, gc, x-sx, y-sy );
|
|
}
|
|
XSetTSOrigin( dpy, gc, x-sx, y-sy );
|
|
XFillRectangle( dpy, hd, gc, x, y, sw, sh );
|
|
XSetTSOrigin( dpy, gc, 0, 0 );
|
|
XSetFillStyle( dpy, gc, FillSolid );
|
|
if ( !selfmask ) {
|
|
if ( pdev == paintEventDevice && paintEventClipRegion ) {
|
|
x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
|
|
} else {
|
|
x11ClearClipRegion(dpy, gc, 0, rendhd);
|
|
}
|
|
}
|
|
} else {
|
|
bitBlt( pdev, x, y, &pixmap, sx, sy, sw, sh, (RasterOp)rop );
|
|
}
|
|
return;
|
|
}
|
|
|
|
TQRegion rgn = crgn;
|
|
|
|
if ( mask ) { // pixmap has clip mask
|
|
// Implies that clipping is on, either explicit or implicit
|
|
// Create a new mask that combines the mask with the clip region
|
|
|
|
if ( pdev == paintEventDevice && paintEventClipRegion ) {
|
|
if ( hasClipping() )
|
|
rgn = rgn.intersect( *paintEventClipRegion );
|
|
else
|
|
rgn = *paintEventClipRegion;
|
|
}
|
|
|
|
TQBitmap *comb = new TQBitmap( sw, sh );
|
|
comb->detach();
|
|
GC cgc = tqt_xget_temp_gc( pixmap.x11Screen(), TRUE ); // get temporary mono GC
|
|
XSetForeground( dpy, cgc, 0 );
|
|
XFillRectangle( dpy, comb->handle(), cgc, 0, 0, sw, sh );
|
|
XSetBackground( dpy, cgc, 0 );
|
|
XSetForeground( dpy, cgc, 1 );
|
|
int num;
|
|
XRectangle *rects = (XRectangle *)qt_getClipRects( rgn, num );
|
|
XSetClipRectangles( dpy, cgc, -x, -y, rects, num, YXBanded );
|
|
XSetFillStyle( dpy, cgc, FillOpaqueStippled );
|
|
XSetStipple( dpy, cgc, mask->handle() );
|
|
XSetTSOrigin( dpy, cgc, -sx, -sy );
|
|
XFillRectangle( dpy, comb->handle(), cgc, 0, 0, sw, sh );
|
|
XSetTSOrigin( dpy, cgc, 0, 0 ); // restore cgc
|
|
XSetFillStyle( dpy, cgc, FillSolid );
|
|
XSetClipMask( dpy, cgc, None );
|
|
mask = comb; // it's deleted below
|
|
|
|
XSetClipMask( dpy, gc, mask->handle() );
|
|
XSetClipOrigin( dpy, gc, x, y );
|
|
}
|
|
|
|
if ( mono ) {
|
|
XSetBackground( dpy, gc, bg_col.pixel(scrn) );
|
|
XSetFillStyle( dpy, gc, FillOpaqueStippled );
|
|
XSetStipple( dpy, gc, pixmap.handle() );
|
|
XSetTSOrigin( dpy, gc, x-sx, y-sy );
|
|
XFillRectangle( dpy, hd, gc, x, y, sw, sh );
|
|
XSetTSOrigin( dpy, gc, 0, 0 );
|
|
XSetFillStyle( dpy, gc, FillSolid );
|
|
} else {
|
|
#if !defined(QT_NO_XFTFREETYPE) && !defined(QT_NO_XRENDER)
|
|
Picture pict = rendhd ? XftDrawPicture((XftDraw *) rendhd) : None;
|
|
TQPixmap *alpha = pixmap.data->alphapm;
|
|
|
|
if ( pict && pixmap.x11RenderHandle() &&
|
|
alpha && alpha->x11RenderHandle()) {
|
|
XRenderComposite(dpy, PictOpOver, pixmap.x11RenderHandle(),
|
|
alpha->x11RenderHandle(), pict,
|
|
sx, sy, sx, sy, x, y, sw, sh);
|
|
} else
|
|
#endif // !QT_NO_XFTFREETYPE && !QT_NO_XRENDER
|
|
{
|
|
XCopyArea( dpy, pixmap.handle(), hd, gc, sx, sy, sw, sh, x, y );
|
|
}
|
|
}
|
|
|
|
if ( mask ) { // restore clipping
|
|
XSetClipOrigin( dpy, gc, 0, 0 );
|
|
XSetRegion( dpy, gc, rgn.handle() );
|
|
delete mask; // delete comb, created above
|
|
}
|
|
}
|
|
|
|
|
|
/* Internal, used by drawTiledPixmap */
|
|
|
|
static void drawTile( TQPainter *p, int x, int y, int w, int h,
|
|
const TQPixmap &pixmap, int xOffset, int yOffset )
|
|
{
|
|
int yPos, xPos, drawH, drawW, yOff, xOff;
|
|
yPos = y;
|
|
yOff = yOffset;
|
|
while( yPos < y + h ) {
|
|
drawH = pixmap.height() - yOff; // Cropping first row
|
|
if ( yPos + drawH > y + h ) // Cropping last row
|
|
drawH = y + h - yPos;
|
|
xPos = x;
|
|
xOff = xOffset;
|
|
while( xPos < x + w ) {
|
|
drawW = pixmap.width() - xOff; // Cropping first column
|
|
if ( xPos + drawW > x + w ) // Cropping last column
|
|
drawW = x + w - xPos;
|
|
p->drawPixmap( xPos, yPos, pixmap, xOff, yOff, drawW, drawH );
|
|
xPos += drawW;
|
|
xOff = 0;
|
|
}
|
|
yPos += drawH;
|
|
yOff = 0;
|
|
}
|
|
}
|
|
|
|
#if 0 // see comment in drawTiledPixmap
|
|
/* Internal, used by drawTiledPixmap */
|
|
|
|
static void fillTile( TQPixmap *tile, const TQPixmap &pixmap )
|
|
{
|
|
bitBlt( tile, 0, 0, &pixmap, 0, 0, -1, -1, TQt::CopyROP, TRUE );
|
|
int x = pixmap.width();
|
|
while ( x < tile->width() ) {
|
|
bitBlt( tile, x,0, tile, 0,0, x,pixmap.height(), TQt::CopyROP, TRUE );
|
|
x *= 2;
|
|
}
|
|
int y = pixmap.height();
|
|
while ( y < tile->height() ) {
|
|
bitBlt( tile, 0,y, tile, 0,0, tile->width(),y, TQt::CopyROP, TRUE );
|
|
y *= 2;
|
|
}
|
|
}
|
|
#endif
|
|
|
|
/*!
|
|
Draws a tiled \a pixmap in the specified rectangle.
|
|
|
|
\a (x, y) specifies the top-left point in the paint device that is
|
|
to be drawn onto; with the width and height given by \a w and \a
|
|
h. \a (sx, sy) specifies the top-left point in \a pixmap that is
|
|
to be drawn. The default is (0, 0).
|
|
|
|
Calling drawTiledPixmap() is similar to calling drawPixmap()
|
|
several times to fill (tile) an area with a pixmap, but is
|
|
potentially much more efficient depending on the underlying window
|
|
system.
|
|
|
|
\sa drawPixmap()
|
|
*/
|
|
|
|
void TQPainter::drawTiledPixmap( int x, int y, int w, int h,
|
|
const TQPixmap &pixmap, int sx, int sy )
|
|
{
|
|
int sw = pixmap.width();
|
|
int sh = pixmap.height();
|
|
if (!sw || !sh )
|
|
return;
|
|
if ( sx < 0 )
|
|
sx = sw - -sx % sw;
|
|
else
|
|
sx = sx % sw;
|
|
if ( sy < 0 )
|
|
sy = sh - -sy % sh;
|
|
else
|
|
sy = sy % sh;
|
|
/*
|
|
Requirements for optimizing tiled pixmaps:
|
|
- not an external device
|
|
- not scale or rotshear
|
|
- not mono pixmap
|
|
- no mask
|
|
*/
|
|
TQBitmap *mask = (TQBitmap *)pixmap.mask();
|
|
if ( !testf(ExtDev) && txop <= TxTranslate && pixmap.depth() > 1 &&
|
|
mask == 0 ) {
|
|
if ( txop == TxTranslate )
|
|
map( x, y, &x, &y );
|
|
|
|
#if !defined(QT_NO_XFTFREETYPE) && !defined(QT_NO_XRENDER)
|
|
Picture pict = rendhd ? XftDrawPicture((XftDraw *) rendhd) : None;
|
|
TQPixmap *alpha = pixmap.data->alphapm;
|
|
|
|
if (pict && pixmap.x11RenderHandle() && alpha && alpha->x11RenderHandle()) {
|
|
// this is essentially drawTile() from above, inlined for
|
|
// the XRenderComposite call
|
|
int yPos, xPos, drawH, drawW, yOff, xOff;
|
|
yPos = y;
|
|
yOff = sy;
|
|
while( yPos < y + h ) {
|
|
drawH = pixmap.height() - yOff; // Cropping first row
|
|
if ( yPos + drawH > y + h ) // Cropping last row
|
|
drawH = y + h - yPos;
|
|
xPos = x;
|
|
xOff = sx;
|
|
while( xPos < x + w ) {
|
|
drawW = pixmap.width() - xOff; // Cropping first column
|
|
if ( xPos + drawW > x + w ) // Cropping last column
|
|
drawW = x + w - xPos;
|
|
XRenderComposite(dpy, PictOpOver, pixmap.x11RenderHandle(),
|
|
alpha->x11RenderHandle(), pict,
|
|
xOff, yOff, xOff, yOff, xPos, yPos, drawW, drawH);
|
|
xPos += drawW;
|
|
xOff = 0;
|
|
}
|
|
yPos += drawH;
|
|
yOff = 0;
|
|
}
|
|
return;
|
|
}
|
|
#endif // !QT_NO_XFTFREETYPE && !QT_NO_XRENDER
|
|
|
|
XSetTile( dpy, gc, pixmap.handle() );
|
|
XSetFillStyle( dpy, gc, FillTiled );
|
|
XSetTSOrigin( dpy, gc, x-sx, y-sy );
|
|
XFillRectangle( dpy, hd, gc, x, y, w, h );
|
|
XSetTSOrigin( dpy, gc, 0, 0 );
|
|
XSetFillStyle( dpy, gc, FillSolid );
|
|
return;
|
|
}
|
|
|
|
#if 0
|
|
// maybe there'll be point in this again, but for the time all it
|
|
// does is make trouble for the postscript code.
|
|
if ( sw*sh < 8192 && sw*sh < 16*w*h ) {
|
|
int tw = sw;
|
|
int th = sh;
|
|
while( th * tw < 4096 && ( th < h || tw < w ) ) {
|
|
if ( h/th > w/tw )
|
|
th *= 2;
|
|
else
|
|
tw *= 2;
|
|
}
|
|
TQPixmap tile( tw, th, pixmap.depth(), TQPixmap::NormalOptim );
|
|
fillTile( &tile, pixmap );
|
|
if ( mask ) {
|
|
TQBitmap tilemask( tw, th, TQPixmap::NormalOptim );
|
|
fillTile( &tilemask, *mask );
|
|
tile.setMask( tilemask );
|
|
}
|
|
drawTile( this, x, y, w, h, tile, sx, sy );
|
|
} else {
|
|
drawTile( this, x, y, w, h, pixmap, sx, sy );
|
|
}
|
|
#else
|
|
// for now we'll just output the original and let the postscript
|
|
// code make what it can of it. qpicture will be unhappy.
|
|
drawTile( this, x, y, w, h, pixmap, sx, sy );
|
|
#endif
|
|
}
|
|
|
|
#if 0
|
|
//
|
|
// Generate a string that describes a transformed bitmap. This string is used
|
|
// to insert and find bitmaps in the global pixmap cache.
|
|
//
|
|
|
|
static TQString gen_text_bitmap_key( const TQWMatrix &m, const TQFont &font,
|
|
const TQString &str, int pos, int len )
|
|
{
|
|
TQString fk = font.key();
|
|
int sz = 4*2 + len*2 + fk.length()*2 + sizeof(double)*6;
|
|
TQByteArray buf(sz);
|
|
uchar *p = (uchar *)buf.data();
|
|
*((double*)p)=m.m11(); p+=sizeof(double);
|
|
*((double*)p)=m.m12(); p+=sizeof(double);
|
|
*((double*)p)=m.m21(); p+=sizeof(double);
|
|
*((double*)p)=m.m22(); p+=sizeof(double);
|
|
*((double*)p)=m.dx(); p+=sizeof(double);
|
|
*((double*)p)=m.dy(); p+=sizeof(double);
|
|
TQChar h1( '$' );
|
|
TQChar h2( 'q' );
|
|
TQChar h3( 't' );
|
|
TQChar h4( '$' );
|
|
*((TQChar*)p)=h1; p+=2;
|
|
*((TQChar*)p)=h2; p+=2;
|
|
*((TQChar*)p)=h3; p+=2;
|
|
*((TQChar*)p)=h4; p+=2;
|
|
memcpy( (char*)p, (char*)(str.unicode()+pos), len*2 ); p += len*2;
|
|
memcpy( (char*)p, (char*)fk.unicode(), fk.length()*2 ); p += fk.length()*2;
|
|
return TQString( (TQChar*)buf.data(), buf.size()/2 );
|
|
}
|
|
|
|
static TQBitmap *get_text_bitmap( const TQString &key )
|
|
{
|
|
return (TQBitmap*)TQPixmapCache::find( key );
|
|
}
|
|
|
|
static void ins_text_bitmap( const TQString &key, TQBitmap *bm )
|
|
{
|
|
if ( !TQPixmapCache::insert(key, bm) ) // cannot insert pixmap
|
|
delete bm;
|
|
}
|
|
#endif
|
|
|
|
void qt_draw_transformed_rect( TQPainter *p, int x, int y, int w, int h, bool fill )
|
|
{
|
|
XPoint points[5];
|
|
int xp = x, yp = y;
|
|
p->map( xp, yp, &xp, &yp );
|
|
points[0].x = xp;
|
|
points[0].y = yp;
|
|
xp = x + w; yp = y;
|
|
p->map( xp, yp, &xp, &yp );
|
|
points[1].x = xp;
|
|
points[1].y = yp;
|
|
xp = x + w; yp = y + h;
|
|
p->map( xp, yp, &xp, &yp );
|
|
points[2].x = xp;
|
|
points[2].y = yp;
|
|
xp = x; yp = y + h;
|
|
p->map( xp, yp, &xp, &yp );
|
|
points[3].x = xp;
|
|
points[3].y = yp;
|
|
points[4] = points[0];
|
|
|
|
if ( fill )
|
|
XFillPolygon( p->dpy, p->hd, p->gc, points, 4, Convex, CoordModeOrigin );
|
|
else
|
|
XDrawLines( p->dpy, p->hd, p->gc, points, 5, CoordModeOrigin );
|
|
}
|
|
|
|
void qt_draw_background( TQPainter *p, int x, int y, int w, int h )
|
|
{
|
|
if (p->testf(TQPainter::ExtDev)) {
|
|
if (p->pdev->devType() == TQInternal::Printer)
|
|
p->fillRect(x, y, w, h, p->bg_col);
|
|
return;
|
|
}
|
|
XSetForeground( p->dpy, p->gc, p->bg_col.pixel(p->scrn) );
|
|
qt_draw_transformed_rect( p, x, y, w, h, TRUE);
|
|
XSetForeground( p->dpy, p->gc, p->cpen.color().pixel(p->scrn) );
|
|
}
|
|
|
|
/*!
|
|
Draws at most \a len characters of the string \a str at position
|
|
\a (x, y).
|
|
|
|
\a (x, y) is the base line position. Note that the meaning of \a y
|
|
is not the same for the two drawText() varieties.
|
|
*/
|
|
void TQPainter::drawText( int x, int y, const TQString &str, int len, TQPainter::TextDirection dir )
|
|
{
|
|
drawText( x, y, str, 0, len, dir );
|
|
}
|
|
|
|
/*!
|
|
Draws at most \a len characters starting at position \a pos from the
|
|
string \a str to position \a (x, y).
|
|
|
|
\a (x, y) is the base line position. Note that the meaning of \a y
|
|
is not the same for the two drawText() varieties.
|
|
*/
|
|
void TQPainter::drawText( int x, int y, const TQString &str, int pos, int len, TQPainter::TextDirection dir )
|
|
{
|
|
if ( !isActive() )
|
|
return;
|
|
if (len < 0)
|
|
len = str.length() - pos;
|
|
if ( len <= 0 || pos >= (int)str.length() ) // empty string
|
|
return;
|
|
if ( pos + len > (int)str.length() )
|
|
len = str.length() - pos;
|
|
|
|
if ( testf(DirtyFont) ) {
|
|
updateFont();
|
|
}
|
|
|
|
if ( testf(ExtDev) && pdev->devType() != TQInternal::Printer ) {
|
|
TQPDevCmdParam param[3];
|
|
TQPoint p(x, y);
|
|
TQString string = str.mid( pos, len );
|
|
param[0].point = &p;
|
|
param[1].str = &string;
|
|
param[2].ival = TQFont::Latin;
|
|
if ( !pdev->cmd(TQPaintDevice::PdcDrawText2, this, param) || !hd )
|
|
return;
|
|
}
|
|
|
|
bool simple = (dir == TQPainter::Auto) && str.simpleText();
|
|
// we can't take the complete string here as we would otherwise
|
|
// get quadratic behaviour when drawing long strings in parts.
|
|
// we do however need some chars around the part we paint to get arabic shaping correct.
|
|
// ### maybe possible to remove after cursor restrictions work in TQRT
|
|
int start;
|
|
int end;
|
|
if ( simple ) {
|
|
start = pos;
|
|
end = pos+len;
|
|
} else {
|
|
start = TQMAX( 0, pos - 8 );
|
|
end = TQMIN( (int)str.length(), pos + len + 8 );
|
|
}
|
|
TQConstString cstr( str.unicode() + start, end - start );
|
|
pos -= start;
|
|
|
|
TQTextEngine engine( cstr.string(), pfont ? pfont->d : cfont.d );
|
|
TQTextLayout layout( &engine );
|
|
|
|
// this is actually what beginLayout does. Inlined here, so we can
|
|
// avoid the bidi algorithm if we don't need it.
|
|
engine.itemize( simple ? TQTextEngine::NoBidi|TQTextEngine::SingleLine : TQTextEngine::Full|TQTextEngine::SingleLine );
|
|
engine.currentItem = 0;
|
|
engine.firstItemInLine = -1;
|
|
|
|
if ( dir != Auto ) {
|
|
int level = dir == RTL ? 1 : 0;
|
|
for ( int i = engine.items.size(); i >= 0; i-- )
|
|
engine.items[i].analysis.bidiLevel = level;
|
|
}
|
|
|
|
if ( !simple ) {
|
|
layout.setBoundary( pos );
|
|
layout.setBoundary( pos + len );
|
|
}
|
|
|
|
// small hack to force skipping of unneeded items
|
|
start = 0;
|
|
while ( engine.items[start].position < pos )
|
|
++start;
|
|
engine.currentItem = start;
|
|
layout.beginLine( 0xfffffff );
|
|
end = start;
|
|
while ( !layout.atEnd() && layout.currentItem().from() < pos + len ) {
|
|
layout.addCurrentItem();
|
|
end++;
|
|
}
|
|
TQFontMetrics fm(fontMetrics());
|
|
int ascent = fm.ascent(), descent = fm.descent();
|
|
int left, right;
|
|
layout.endLine( 0, 0, TQt::SingleLine|TQt::AlignLeft, &ascent, &descent, &left, &right );
|
|
|
|
// do _not_ call endLayout() here, as it would clean up the shaped items and we would do shaping another time
|
|
// for painting.
|
|
|
|
int textFlags = 0;
|
|
if ( cfont.d->underline ) textFlags |= TQt::Underline;
|
|
if ( cfont.d->overline ) textFlags |= TQt::Overline;
|
|
if ( cfont.d->strikeOut ) textFlags |= TQt::StrikeOut;
|
|
|
|
if ( bg_mode == OpaqueMode )
|
|
qt_draw_background( this, x, y-ascent, right-left, ascent+descent+1);
|
|
|
|
for ( int i = start; i < end; i++ ) {
|
|
TQTextItem ti;
|
|
ti.item = i;
|
|
ti.engine = &engine;
|
|
|
|
drawTextItem( x, y - ascent, ti, textFlags );
|
|
}
|
|
layout.d = 0;
|
|
}
|
|
|
|
|
|
/*! \internal
|
|
Draws the text item \a ti at position \a (x, y ).
|
|
|
|
This method ignores the painters background mode and
|
|
color. drawText and qt_format_text have to do it themselves, as
|
|
only they know the extents of the complete string.
|
|
|
|
It ignores the font set on the painter as the text item has one of its own.
|
|
|
|
The underline and strikeout parameters of the text items font are
|
|
ignored aswell. You'll need to pass in the correct flags to get
|
|
underlining and strikeout.
|
|
*/
|
|
void TQPainter::drawTextItem( int x, int y, const TQTextItem &ti, int textFlags )
|
|
{
|
|
if ( testf(ExtDev) ) {
|
|
TQPDevCmdParam param[2];
|
|
TQPoint p(x, y);
|
|
param[0].point = &p;
|
|
param[1].textItem = &ti;
|
|
bool retval = pdev->cmd(TQPaintDevice::PdcDrawTextItem, this, param);
|
|
if ( !retval || !hd )
|
|
return;
|
|
}
|
|
|
|
TQTextEngine *engine = ti.engine;
|
|
TQScriptItem *si = &engine->items[ti.item];
|
|
|
|
engine->shape( ti.item );
|
|
TQFontEngine *fe = si->fontEngine;
|
|
assert( fe != 0 );
|
|
|
|
x += si->x;
|
|
y += si->y;
|
|
|
|
fe->draw( this, x, y, engine, si, textFlags );
|
|
}
|
|
|
|
#if TQT_VERSION >= 0x040000
|
|
#error "remove current position and associated methods"
|
|
#endif
|
|
/*!
|
|
\obsolete
|
|
Returns the current position of the pen.
|
|
|
|
\sa moveTo()
|
|
*/
|
|
TQPoint TQPainter::pos() const
|
|
{
|
|
return curPt;
|
|
}
|